Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(2-(Dimethylamino)ethyl)triphenylphosphonium bromide
2-DimethylaminoethyltriphenylphosphoniumBromide>(2-Dimethylaminoethyl)triphenylphosphonium bromide · 2-(dimethylamino)ethyl-triphenylphosphanium,bromide · (2-Dimethylaminoethyl)triphenylphosphonium bromide,97%
식별자 및 물리적 특성
| CAS No. | 21331-80-6 |
|---|---|
| 분자식 | C22H25BrNP |
| 평균 분자량 | 414.3 g/mol |
| 단동위원소 질량 | 413.09079853 g/mol |
| SMILES | CN(C)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChIKey | YIIHEMGEQQWSMA-UHFFFAOYSA-M |
| PubChem CID | 2724136 |
| EC No. | 244-335-2 |
| DTXSID | DTXSID30943890 |
화학 및 물리적 성질
| 극성 표면적 | 3.2 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 25 |
| 형식 전하 | 0 |
| 복잡도 | 303 |
| 녹는점 | 195-200 °C (dec.)(lit.) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | 가루 |
| 색상 | 거의 흰색~황갈색 |
| BRN | 4072092 |
화학적 성질
almost white to yellow-brown powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29310099 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| F 고인화성물질 | 3 |
용도
개요
2-DiMethylaMinoethyltriphenylphosphoniuM BroMide is precursor to dimethylaminoethylidenetriphenylphosphorane, which condenses with aldehydes and ketones to give allylic amines.
용도
[2-(Dimethylamino)ethyl]triphenylphosphonium Bromide, can be used as a polymerizable cationic surfactant for the intercalation of montmorillonite (MMT), used in the synthesis of polystyrene-clay nanocomposite materials. It can also be used for the synthesis of some analogs of morphine 6-glucuronide through Wittig reactions.