Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,4-Difluorophenyl isocyanate
3,4-Difluorophenyl isocyanate · 3,4-DifluorophenylIsocyanate>3,4-Difluoro-1-isocyanatobenzene · 3,4-Difluorophenyl isocyanate 2GR · Benzene, 1,2-difluoro-4-isocyanato- · Isocyanic Acid 3,4-Difluorophenyl Ester
식별자 및 물리적 특성
| CAS No. | 42601-04-7 |
|---|---|
| 분자식 | C7H3F2NO |
| 평균 분자량 | 155.1 g/mol |
| 단동위원소 질량 | 155.01827016 g/mol |
| SMILES | O=C=Nc1ccc(F)c(F)c1 |
| InChIKey | YBWJVFMNWMLZEN-UHFFFAOYSA-N |
| PubChem CID | 2734708 |
| EC No. | 627-602-1 |
| DTXSID | DTXSID80370455 |
화학 및 물리적 성질
| XLogP | 3.1 |
|---|---|
| 극성 표면적 | 29.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 179 |
| 끓는 점 | 164 °C(lit.) |
| 밀도 | 1.326 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.498(lit.) |
| 인화점 | 145 °F |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 액체 |
| 색상 | 노란색 |
| InChI | InChI=1S/C7H3F2NO/c8-6-2-1-5(10-4-11)3-7(6)9/h1-3H |
| InChIKey | YBWJVFMNWMLZEN-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(N=C=O)C=C1F |
화학적 성질
Yellow liquid
안전 및 규제
| GHS 분류 | WarningH302 (95.3%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (95.3%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2206 6.1/PG 2 |
| 관세 코드 | 29291090 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn,T |
| 안전 문구(S) | 26-36 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Resp. Sens. 1Skin Irrit. 2Skin Sens. 1STOT SE 3 |
| 위험 참고 사항 | Toxic/Lachrymatory/Moisture Sensitive |
| 저장 분류 | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
용도
용도
3,4-Difluorophenyl isocyanate may be used in the preparation of (±)-trans-4-[4-cyano-3-(trifluoromethyl)phenyl]-N-(3,4-difluorophenyl)-2,5-dimethylpiperazine-1-carboxamide.
일반 설명
3,4-Difluorophenyl isocyanate, also known as 1,2-difluoro-4-isocyanatobenzene, is an organic building block containing an isocyanate group.