Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,6-Dimethoxypyrimidine-4-carboxylic acid
2,6-DIMETHOXYPYRIMIDINE-4-CARBOXYLIC ACID · TIMTEC-BB SBB010109 · ASINEX-REAG BAS 02085805 · 2,6-dimethoxypyrimidine-4-carboxylicaci · 2,4-DIMETHOXYPYRIMIDINE-6-CARBOXYLIC ACID · 2,6-Dimethoxy-4-pyrimidinecarboxylic acid · 4-Pyrimidinecarboxylic acid, 2,6-dimethoxy- · 2,6-Dimethoxypyrimidine-4-carboxylic acid 95+%
식별자 및 물리적 특성
| CAS No. | 59864-30-1 |
|---|---|
| 분자식 | C7H8N2O4 |
| 평균 분자량 | 184.15 g/mol |
| 단동위원소 질량 | 184.04840674 g/mol |
| SMILES | COc1cc(C(=O)O)nc(OC)n1 |
| InChIKey | APCAETLUMQRTDK-UHFFFAOYSA-N |
| PubChem CID | 2736210 |
| ChEMBL | CHEMBL1586042 |
| EC No. | 674-469-0 |
| DTXSID | DTXSID20371204 |
화학 및 물리적 성질
| XLogP | 0.7 |
|---|---|
| 극성 표면적 | 81.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 187 |
| 용해도 | >27.6 [ug/mL] (The mean of the results at pH 7.4) |
| 녹는점 | 162 |
| 끓는 점 | 93-98°C/0.3mm |
| 밀도 | 1.349±0.06 g/cm3(Predicted) |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 2.85±0.30(Predicted) |
| 색상 | 하얀색 |
| InChI | InChI=1S/C7H8N2O4/c1-12-5-3-4(6(10)11)8-7(9-5)13-2/h3H,1-2H3,(H,10,11) |
| InChIKey | APCAETLUMQRTDK-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC(OC)=CC(C(O)=O)=N1 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 2933599590 |
| 위험 표시 | Xi |
| 위험 참고 사항 | Irritant |
용도
용도
2,4-Dimethoxypyrimidine-6-carboxylic Acid is a reactant or reagent in the synthetic preparation of racemic cylindrospermopsin.