Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-(2-디메틸아미노에틸)피페라진
1-(2-디메틸아미노에틸)피페라진 · iperazine · TIMTEC-BB SBB010067 · RARECHEM AH CK 0089 · N,N-Dimetylaminoethyl piperazine · 1-[2-(Dimethylamino)-ethyl]-pipera · 1-(2-Dimethylaminoethyl)piperazine · N,N-DIMETHYL-2-PIPERAZINOETHYLAMINE
식별자 및 물리적 특성
| CAS No. | 3644-18-6 |
|---|---|
| 분자식 | C8H19N3 |
| 평균 분자량 | 157.26 g/mol |
| 단동위원소 질량 | 157.15789761 g/mol |
| SMILES | CN(C)CCN1CCNCC1 |
| InChIKey | LGDNSGSJKBIVFG-UHFFFAOYSA-N |
| PubChem CID | 2736229 |
| EC No. | 628-996-8 |
| DTXSID | DTXSID70371219 |
| 현지명 | 1-(2-디메틸아미노에틸)피페라진 |
화학 및 물리적 성질
| XLogP | -0.4 |
|---|---|
| 극성 표면적 | 18.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 97.5 |
| 끓는 점 | 63 °C |
| 밀도 | 0.92g/ml |
| 굴절률 | n20/D 1.479 |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| pKa(산도 계수) | 9.50±0.28(Predicted) |
| 물리적 상태 | 액체 |
| 색상 | 무색 |
| BRN | 105841 |
| InChI | InChI=1S/C8H19N3/c1-9-3-4-11-7-5-10(2)6-8-11/h9H,3-8H2,1-2H3 |
| InChIKey | LZEBHQQBLHMJOG-UHFFFAOYSA-N |
| SMILES | N1(CCNC)CCN(C)CC1 |
화학적 성질
Clear yellow liquid
안전 및 규제
| GHS 분류 | DangerH314 (97.6%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (97.6%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2735 8/PG 3 |
| 관세 코드 | 29349990 |
| 위험 문구(R) | 34 |
| 위험 표시 | C,Xi |
| 안전 문구(S) | 26-36/37/39-45 |
| 위험 등급 | IRRITANTSkin Corr. 1B |
| F 고인화성물질 | 10-34 |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |