Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-Bromo-4,5-difluoro-2-methoxybenzene
1-BroMo-4,5-difluoro-2-Methoxybenzene · CAS:202865-58-5 · 2-BROMO-4,5-DIFLUOROANISOLE · 2-Bromo-4,5-difluoroanisole98% · Benzene, 1-bromo-4,5-difluoro-2-methoxy- · 2-Bromo-4,5-difluoroanisole ISO 9001：2015 REACH · 1-Bromo-4,5-difluoro-2-methoxybenzene, 2-Bromo-4,5-difluorophenyl methyl ether
식별자 및 물리적 특성
| CAS No. | 202865-58-5 |
|---|---|
| 분자식 | C7H5BrF2O |
| 평균 분자량 | 223.01 g/mol |
| 단동위원소 질량 | 221.94918332 g/mol |
| SMILES | COc1cc(F)c(F)cc1Br |
| InChIKey | DKARISQFDBAJEZ-UHFFFAOYSA-N |
| PubChem CID | 2736262 |
| EC No. | 606-490-8 |
| DTXSID | DTXSID70371239 |
화학 및 물리적 성질
| XLogP | 2.8 |
|---|---|
| 극성 표면적 | 9.2 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 134 |
| 끓는 점 | 200.6±35.0 °C(Predicted) |
| 밀도 | 1.615±0.06 g/cm3(Predicted) |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 저융점 고체 |
| 색상 | 무색 |
| 용해도 | 물과 섞이거나 혼합하기 어렵지 않습니다. |
| InChI | InChI=1S/C7H5BrF2O/c1-11-7-3-6(10)5(9)2-4(7)8/h2-3H,1H3 |
| InChIKey | DKARISQFDBAJEZ-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(F)=C(F)C=C1OC |
안전 및 규제
| GHS 분류 | DangerH301 (86.7%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P316, P302+P352, P305+P351+P338, P321, P330, P332+P317, P337+P317, P362+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (86.7%) |
| 관세 코드 | 2909309090 |
| 위험 문구(R) | 20/21/22-36/37/38-25 |
| 위험 표시 | Xi,T |
| 안전 문구(S) | 26-36/37/39-45 |
| 위험 등급 | IRRITANT |
용도
용도
It is employed as a intermediate for pharmaceuticals.