Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Bromo-2,5-difluoronitrobenzene
1-BROMO-2,5-DIFLUORO-4-NITROBENZENE · BUTTPARK 29\01-58 · 4-Bromo-2,5-difluoronitrobenzene · 2,5-Difluoro-4-bromonitrobenzene · 5-Bromo-1,4-difluoro-2-nitrobenzene · 4-Bromo-2,5-difluoronitrobenzene >Benzene, 1-bromo-2,5-difluoro-4-nitro- · 4-BROMO-2,5-DIFLUORONITROBENZENE ISO 9001：2015 REACH
식별자 및 물리적 특성
| CAS No. | 167415-27-2 |
|---|---|
| 분자식 | C6H2BrF2NO2 |
| 평균 분자량 | 237.99 g/mol |
| 단동위원소 질량 | 236.92369684 g/mol |
| SMILES | O=[N+]([O-])c1cc(F)c(Br)cc1F |
| InChIKey | GJFYMYJYPARISZ-UHFFFAOYSA-N |
| PubChem CID | 2736286 |
| EC No. | 670-770-6 |
| DTXSID | DTXSID20371249 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 187 |
| 녹는점 | 55 °C |
| 끓는 점 | 262.4±35.0 °C(Predicted) |
| 밀도 | 1.890±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | powder to crystal |
| 색상 | Light orange to Yellow to Green |
| BRN | 7411347 |
화학적 성질
light yellow solid
안전 및 규제
| GHS 분류 | WarningH302+H312+H332 (10%): Harmful if swallowed, in contact with skin or if inhaled [Warning Acute toxicity, oralacute toxicity, dermalacute toxicity, inhalation]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 10 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 관세 코드 | 29042090 |
| 위험 문구(R) | 36/37/38-20/21/22 |
| 위험 표시 | Xi,T |
| 안전 문구(S) | 26-36/37/39-36/37 |
| 위험 등급 | IRRITANT, TOXIC |
| 위험 참고 사항 | Irritant |