Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Bromo-4,5-difluorophenol
2-Bromo-4,5-difL · 2-Bromo-4,5-difluoro · 2-Bromo-4,5-difluorophen · 2-BROMO-4,5-DIFLOUO PHENOL · 2-BROMO-4,5-DIFLUOROPHENOL · Phenol, 2-bromo-4,5-difluoro- · 2-Bromo-4,5-difluorophenol97% · 2-Bromo-4,5-difluorophenol 97%
식별자 및 물리적 특성
| CAS No. | 166281-37-4 |
|---|---|
| 분자식 | C6H3BrF2O |
| 평균 분자량 | 208.99 g/mol |
| 단동위원소 질량 | 207.93353326 g/mol |
| SMILES | Oc1cc(F)c(F)cc1Br |
| InChIKey | FCYZOOHWUOEAOX-UHFFFAOYSA-N |
| PubChem CID | 2736288 |
| EC No. | 605-435-5 |
| DTXSID | DTXSID30371250 |
화학 및 물리적 성질
| XLogP | 2.5 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 122 |
| 끓는 점 | 208.8±35.0 °C(Predicted) |
| 밀도 | 1.829 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.531(lit.) |
| 인화점 | 178 °F |
| 저장 조건 | Store at room temperature |
| pKa(산도 계수) | 7.46±0.23(Predicted) |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색~황색 |
| BRN | 8355005 |
| InChI | InChI=1S/C6H3BrF2O/c7-3-1-4(8)5(9)2-6(3)10/h1-2,10H |
| InChIKey | FCYZOOHWUOEAOX-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=C(F)C=C1Br |
화학적 성질
Colorless to yellow liquid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN2811 |
| 관세 코드 | 29081990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Harmful |
| 저장 분류 | 10 - Combustible liquids |
용도
일반 설명
2-Bromo-4,5-difluorophenol is reported to undergo palladium-catalyzed cyclotrimerization to yield hexafluoro- and trimethoxytriphenylene derivatives.