Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-(2-Bromo-4-fluorophenyl)ethan-1-one
1-(2-broMo-4-fluorophenyl)ethan-1-one · 2'-Bromo-4'-fluoroacetophenone · 2-Methyl-29-nitrobenzyl&chloride · 1-Acetyl-2-bromo-4-fluorobenzene · 2'-Bromo-4'-fluoroacetophenone97% · 1-(2-BroMo-4-fluorophenyl)ethanone · 2'-Bromo-4'-fluoroacetophenone 97% · Ethanone,1-(2-bromo-4-fluorophenyl)-
식별자 및 물리적 특성
| CAS No. | 1006-39-9 |
|---|---|
| 분자식 | C8H6BrFO |
| 평균 분자량 | 217.03 g/mol |
| 단동위원소 질량 | 215.95860513 g/mol |
| SMILES | CC(=O)c1ccc(F)cc1Br |
| InChIKey | RCXFSBRMWBFWMH-UHFFFAOYSA-N |
| PubChem CID | 2736304 |
| EC No. | 600-117-2 |
| DTXSID | DTXSID80371260 |
화학 및 물리적 성질
| XLogP | 2.4 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 160 |
| 녹는점 | 48-50°C |
| 끓는 점 | 150°C 12mm |
| 밀도 | 1.535±0.06 g/cm3(Predicted) |
| 굴절률 | 1.549 |
| 인화점 | 110°C |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름, 메탄올에 용해됨 |
| 물리적 상태 | 액체 |
| 색상 | Clear, pale lemon |
| BRN | 2249797 |
| InChI | InChI=1S/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
| InChIKey | RCXFSBRMWBFWMH-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(F)C=C1Br)C |
화학적 성질
Pale Yellow Oil
안전 및 규제
| GHS 분류 | DangerH314 (12.5%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P351+P338, P305+P354+P338, P316, P319, P321, P332+P317, P337+P317, P362+P364, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 8 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (12.5%) |
| 관세 코드 | 2914790090 |
| 위험 문구(R) | 36/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 참고 사항 | Irritant |