Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-Bromo-2-fluorobenzoic acid
BUTTPARK 14\01-30 · 3-Bromo-2-fluorobenzoic · 3-BROMO-2-FLUOROBENZOIC ACID · Benzoic acid, 3-bromo-2-fluoro- · 3-Bromo-2-fluorobenzoic acid,98% · 3-Bromo-2-fluorobenzoic Acid >3-Bromo-2-fluorobenzoic acid 97%+ · 3-Bromo-2-fluorobenzoic acid 97% · 2-fluoro-3-bromobenzoic acid,3-Bromo-2-fluoro-benzoic acid,3-Bromo-2-Fluorobenzoic acid
식별자 및 물리적 특성
| CAS No. | 161957-56-8 |
|---|---|
| 분자식 | C7H4BrFO2 |
| 평균 분자량 | 219.01 g/mol |
| 단동위원소 질량 | 217.93786969 g/mol |
| SMILES | O=C(O)c1cccc(Br)c1F |
| InChIKey | UVKURTLVTLRSSM-UHFFFAOYSA-N |
| PubChem CID | 2736313 |
| EC No. | 630-302-3 |
| DTXSID | DTXSID00371267 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 163 |
| 녹는점 | 168 °C |
| 끓는 점 | 298.2±25.0 °C(Predicted) |
| 밀도 | 1.789±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 2.88±0.10(Predicted) |
| 색상 | 흰색에서 밝은 노란색 |
| InChI | InChI=1S/C7H4BrFO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H,10,11) |
| InChIKey | UVKURTLVTLRSSM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Br)=C1F |
화학적 성질
Off-white powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 9 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 2916399090 |
| 위험 문구(R) | 36 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26 |
| 위험 등급 | IRRITANT |