Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Bromo-1,1,1,2,3,3,3-heptafluoropropane
uoropropane · 2-BromoheptafL · Sevofluorobromopropane · Bromoheptafluoropropane · Heptafluorobromopropane · 2-Bromoheptafluoropropane · Perfluoroisopropyl broMide · 2-Bromoheptafluoropropane99%
식별자 및 물리적 특성
| CAS No. | 422-77-5 |
|---|---|
| 분자식 | C3BrF7 |
| 평균 분자량 | 248.92 g/mol |
| 단동위원소 질량 | 247.90716 g/mol |
| SMILES | FC(F)(F)C(F)(Br)C(F)(F)F |
| InChIKey | SULCAUVYSILBCB-UHFFFAOYSA-N |
| PubChem CID | 2736340 |
| ChEMBL | CHEMBL476635 |
| EC No. | 610-009-7 |
| DTXSID | DTXSID20371289 |
화학 및 물리적 성질
| XLogP | 3.5 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 129 |
| 끓는 점 | 14°C |
| 밀도 | 1,8 g/cm3 |
| 증기압 | 960.8±0.0 mmHg at 25°C |
| 굴절률 | 1.307 |
| 인화점 | -35.1±18.4 °C |
| InChI | InChI=1S/C3BrF7/c4-1(5,2(6,7)8)3(9,10)11 |
| InChIKey | SULCAUVYSILBCB-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C(Br)(F)C(F)(F)F |
안전 및 규제
| GHS 분류 | WarningH280 (100%): Contains gas under pressuremay explode if heated [Warning Gases under pressure]P410+P403</a, and a href="https://pubchem.ncbi.nlm.nih.gov/ghs/#P410+P403">P410+P403 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | REACH registered substance: 2-bromo-1,1,1,2,3,3,3-heptafluoropropane (EC: 610-009-7) |
| Hazard Classes and Categories | Press. Gas (Comp.) (100%) |
| 운송 번호(UN) | 3163 |
| 위험 문구(R) | 23/24/25 |
| 위험 표시 | Xi |
| 안전 문구(S) | 36/37/39 |
| 위험 등급 | IRRITANT, GAS |
| 위험 참고 사항 | Irritant |
용도
용도
2-Bromoheptafluoropropane is a key raw material intermediate for the synthesis of Broflanilide, which is a meta-diamide insecticide for the control of common crop pests, including Lepidoptera, Coleoptera, termites, mosquitoes and flies. Current studies show that Broflanilide has reported excellent insecticidal activity against larvae and adults.