Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-페닐-사이클로헥사논
3-페닐-사이클로헥사논 · 3-phenylcyclohexan-1-one · 3-Phenyl-cyclohexanone · Cyclohexanone, 3-phenyl- · 3-Phenyl-cyclohexanone - [P70908]
식별자 및 물리적 특성
| CAS No. | 20795-53-3 |
|---|---|
| 분자식 | C12H14O |
| 평균 분자량 | 174.24 g/mol |
| 단동위원소 질량 | 174.10446507 g/mol |
| SMILES | O=C1CCCC(c2ccccc2)C1 |
| InChIKey | CJAUDSQXFVZPTO-UHFFFAOYSA-N |
| PubChem CID | 273661 |
| EC No. | 832-830-1 |
| DTXSID | DTXSID70297900 |
| 현지명 | 3-페닐-사이클로헥사논 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 180 |
| 녹는점 | 64 °C |
| 끓는 점 | 287-288 °C(Press: 736 Torr) |
| 밀도 | 1.042±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(소량으로 용해), 메탄올(약간 용해됨) |
| 물리적 상태 | 기름 |
| 색상 | 연한 노란색에서 노란색까지 |
| InChI | InChI=1S/C12H14O/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2 |
| InChIKey | CJAUDSQXFVZPTO-UHFFFAOYSA-N |
| SMILES | C1(=O)CCCC(C2=CC=CC=C2)C1 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]H335 (100%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposureRespiratory tract irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%)Eye Irrit. 2A (100%)STOT SE 3 (100%) |
| 관세 코드 | 2914390090 |
| 위험 등급 | IRRITANT |
용도
용도
3-Phenylcyclohexanone is used in preparation of cyclic Ketone derivatives via ring expansion reaction of beta-selenyl cyclic Ketone derivatives.