Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Methyl 5-chloropentanoate
ClCH2(CH2)3C(O)OCH3 · METHYL 5-CHLOROVALERATE · METHYL 5-CHLOROPENTANOATE · Methyl delta-chlorovalerate · Methyl 5-chlorovalerate 97% · METHYL5-CHLOROPENTANOATE,97% · 5-chlorovaleric acid methyl ester · 5-Chloropentanoic acid, methyl ester
식별자 및 물리적 특성
| CAS No. | 14273-86-0 |
|---|---|
| 분자식 | C6H11ClO2 |
| 평균 분자량 | 150.6 g/mol |
| 단동위원소 질량 | 150.04475727 g/mol |
| SMILES | COC(=O)CCCCCl |
| InChIKey | JAVHFVJOWIQHII-UHFFFAOYSA-N |
| PubChem CID | 274413 |
| EC No. | 624-347-8 |
| DTXSID | DTXSID50298071 |
화학 및 물리적 성질
| XLogP | 1.7 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 83.1 |
| 끓는 점 | 106-107 °C/38 mmHg (lit.) |
| 밀도 | 1.047 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.436(lit.) |
| 인화점 | 194 °F |
| 저장 조건 | Refrigerator, under inert atmosphere |
| 용해도 | 클로로포름(소량으로 용해), 메탄올(약간 용해됨) |
| 물리적 상태 | 기름 |
| 색상 | 무색 |
| InChI | InChI=1S/C6H11ClO2/c1-9-6(8)4-2-3-5-7/h2-5H2,1H3 |
| InChIKey | JAVHFVJOWIQHII-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CCCCCl |
| NIST | Methyl «delta»-chlorovalerate(14273-86-0) |
화학적 성질
CLEAR COLOURLESS LIQUID
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 2915907098 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-27-28-36/37/39-24/25 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 10 - Combustible liquids |
용도
일반 설명
Methyl 5-chlorovalerate undergoes gas phase elimination over the temperature range of 419.6–472.1°C and pressure range of 45–108 torr via intimate ion pair type mechanism.