Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-Boc-4-메틸렌피페리딘
1-Boc-4-메틸렌피페리딘 · TERT-BUTYL 4-METHYLENEPIPERIDINE-1-CARBOXYLATE · tert-butyl 4-methylidenepiperidine-1-carboxylate · 4-METHY · 1-N-BOC-4-METHYLENE-PIPERIDINE · 1-tert-Butoxycarbonyl-4-methylenepiperidine · enepiperidine · N-Boc-4-MethyL
식별자 및 물리적 특성
| CAS No. | 159635-49-1 |
|---|---|
| 분자식 | C11H19NO2 |
| 평균 분자량 | 197.27 g/mol |
| 단동위원소 질량 | 197.14157885 g/mol |
| SMILES | C=C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChIKey | PDTZMULNKGUIEJ-UHFFFAOYSA-N |
| PubChem CID | 2756808 |
| EC No. | 639-305-4 |
| DTXSID | DTXSID90373553 |
| 현지명 | 1-Boc-4-메틸렌피페리딘 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 29.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 230 |
| 끓는 점 | 80°C/1mmHg(lit.) |
| 밀도 | 1g/ml |
| 굴절률 | 1.4630 to 1.4670 |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | -1.41±0.20(Predicted) |
| 색상 | Clear, colourless |
| InChI | InChI=1S/C11H19NO2/c1-9-5-7-12(8-6-9)10(13)14-11(2,3)4/h1,5-8H2,2-4H3 |
| InChIKey | PDTZMULNKGUIEJ-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(=C)CC1 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 7 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 2933399990 |
| 위험 표시 | Xi |
| 위험 참고 사항 | Irritant |
용도
용도
tert-Butyl 4-Methylenepiperidine-1-carboxylate is a useful reagent for the design of anion exchange membranes (AEMs) and ionomers for use in storage devices such as fuel cells and batteries.