Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Ciprofibrate
Ciprobrate · Ciprofibric acid · Cipml · Ciprol · Modalim · Lipanor · Win-35833 · CIPROFIBRATE
식별자 및 물리적 특성
| CAS No. | 52214-84-3 |
|---|---|
| 분자식 | C13H14Cl2O3 |
| 평균 분자량 | 289.15 g/mol |
| 단동위원소 질량 | 288.03199967 g/mol |
| SMILES | CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O |
| InChIKey | KPSRODZRAIWAKH-UHFFFAOYSA-N |
| PubChem CID | 2763 |
| ChEMBL | CHEMBL557555 |
| ChEBI | CHEBI:50867 |
| EC No. | 257-744-6 |
| DTXSID | DTXSID8020331 |
화학 및 물리적 성질
| XLogP | 3.4 |
|---|---|
| 극성 표면적 | 46.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 333 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Collision Cross Section | 171.9 Ų [M-H]- [CCS Type: DTBuffer gas: N2Ionization: ESI-Dataset: TOXCASTSource Identifier: DTXSID8020331] |
| 녹는점 | 114-116° |
| 끓는 점 | 401.74°C (rough estimate) |
| 밀도 | 1.2576 (rough estimate) |
| 굴절률 | 1.5209 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | 물에 거의 녹지 않으며, 무수 에탄올에 잘 녹고, 톨루엔에 녹습니다. |
| pKa(산도 계수) | 3.31±0.10(Predicted) |
| 물리적 상태 | Solid |
| 색상 | 흰색에서 옅은 베이지까지 |
| Merck | 14,2313 |
| 주요 응용 | 제약소분자 약용 |
| InChI | InChI=1S/C13H14Cl2O3/c1-12(2,11(16)17)18-9-5-3-8(4-6-9)10-7-13(10,14)15/h3-6,10H,7H2,1-2H3,(H,16,17) |
| InChIKey | KPSRODZRAIWAKH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(OC1=CC=C(C2CC2(Cl)Cl)C=C1)(C)C |
| EPA | Propanoic acid, 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methyl- (52214-84-3) |
화학적 성질
Off-White to Pale Beige Solid
안전 및 규제
| GHS 분류 | DangerH350 (95%): May cause cancer [Danger Carcinogenicity]P203, P280, P318, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Carc. 1B (95%) |
| Drug Induced Liver Injury | Drug-Induced Liver Injury Severity and Toxicity (DILIst)ciprofibrateDILI PositiveDOI:10.1016/j.drudis.2019.09.022 |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | UF0880000 |
| 관세 코드 | 29189900 |
| 위험 문구(R) | 45 |
| 위험 표시 | T |
| 안전 문구(S) | 53-22-36/37/39-45 |
| 위험 등급 | Carc. 1B |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
개요
Ciprofibrate is a potent, long-acting hypolipidemic agent related to clofibrate, bezafibrate and fenofibrate. It is effective in types IIa, IIb, IIX and IV hyperlipoproteinemias, and produces a beneficial elevation of the anti-atherogenic HDL.
용도
Ciprofibrate is a hypolipemic agent, related structurally to Clofibrate (C586910). Ciprofibrate is used as an antilipemic.