Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Bromo-2-fluorobenzeneboronic acid
RARECHEM AH PB 0054 · 1-Borono-4-bromo-2-fluorobenzene · 4-BROMO-2-FLUOROPHENYLBORONIC ACID · 4-BROMO-2-FLUOROBENZENEBORONIC ACID · 4-Bromo-2-fluorobenzeneboronicacid98% · B-(4-bromo-2-fluorophenyl)boronic acid · 4-Bromo-2-fluorobenzeneboronic acid 98% · Boronic acid, B-(4-bromo-2-fluorophenyl)-
식별자 및 물리적 특성
| CAS No. | 216393-64-5 |
|---|---|
| 분자식 | C6H5BBrFO2 |
| 평균 분자량 | 218.82 g/mol |
| 단동위원소 질량 | 217.95500012 g/mol |
| SMILES | OB(O)c1ccc(Br)cc1F |
| InChIKey | PKZHIIVZRPUZSU-UHFFFAOYSA-N |
| PubChem CID | 2773333 |
| EC No. | 681-891-9 |
| DTXSID | DTXSID10378383 |
화학 및 물리적 성질
| 극성 표면적 | 40.5 |
|---|---|
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 136 |
| 녹는점 | 238-242°C |
| 끓는 점 | 310.6±52.0 °C(Predicted) |
| 밀도 | 1.75±0.1 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| pKa(산도 계수) | 8.12±0.58(Predicted) |
| 물리적 상태 | solid |
| 용해도 | 물에 불용성. |
| InChI | InChI=1S/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
| InChIKey | PKZHIIVZRPUZSU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(Br)C=C1F)(O)O |
안전 및 규제
| GHS 분류 | WarningH302 (20%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (20%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 2931900090 |
| 위험 문구(R) | 36/37/38-36-22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
It is a pharmaceutical intermediate. Arylboronic acids undergo cross-coupling with arenediazonium tetrafluoroborates in dioxane or methanol, catalyzed by palladium acetate in the absence of both added base and phosphine ligand.