Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,4,5-Trifluorobenzyl alcohol
RARECHEM AL BD 0343 · 3,4,5-TRIFLUOROBENZYL ALCOHOL · 3,4,5-Trifluorobenzoyl alcohol · (3,4,5-trifluorophenyl)Methanol · 3,4,5-TRIFLUORO BENZENEMETHANOL · Benzenemethanol, 3,4,5-trifluoro- · 3,4,5-Trifluorobenzyl alcohol 97% · Benzenemethanol, 3,4,5-trifluoro- (9CI)
식별자 및 물리적 특성
| CAS No. | 220227-37-2 |
|---|---|
| 분자식 | C7H5F3O |
| 평균 분자량 | 162.11 g/mol |
| 단동위원소 질량 | 162.02924944 g/mol |
| SMILES | OCc1cc(F)c(F)c(F)c1 |
| InChIKey | HRSFRSLKOPFWMZ-UHFFFAOYSA-N |
| PubChem CID | 2777040 |
| EC No. | 642-879-9 |
| DTXSID | DTXSID50380344 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 119 |
| 끓는 점 | 203-204 °C760 mm Hg(lit.) |
| 밀도 | 1.385 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.4700(lit.) |
| 인화점 | 210 °F |
| 저장 조건 | Storage temp. 2-8°C |
| 물리적 상태 | 융합된 고체 |
| 색상 | White/colourless |
| 용해도 | 물 100g/L에 용해됩니다. |
| BRN | 8681069 |
| InChI | InChI=1S/C7H5F3O/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2,11H,3H2 |
| InChIKey | HRSFRSLKOPFWMZ-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC(F)=C(F)C(F)=C1 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29062990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | IRRITANT |
용도
용도
3,4,5-Trifluorobenzyl alcohol is used as chemical reagent.