Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,4,6-트리플루오로벤질아민
2,4,6-트리플루오로벤질아민 · RARECHEM AL BW 0429 · Chlorfenvinphos Impurity 7 · 2,4,6-Trifluorobenzyl amine · 2,4,6-trifluorobenzylaminine · (2,4,6-Trifluorophenyl)methylamine · 2,4,6-Trifluorobenzylamine 98% GC · Benzenemethanamine, 2,4,6-trifluoro-
식별자 및 물리적 특성
| CAS No. | 214759-21-4 |
|---|---|
| 분자식 | C7H6F3N |
| 평균 분자량 | 161.12 g/mol |
| 단동위원소 질량 | 161.04523385 g/mol |
| SMILES | NCc1c(F)cc(F)cc1F |
| InChIKey | RCHOKTKXVKKNBC-UHFFFAOYSA-N |
| PubChem CID | 2777046 |
| EC No. | 679-198-1 |
| DTXSID | DTXSID90380348 |
| 현지명 | 2,4,6-트리플루오로벤질아민 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 26 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 119 |
| 끓는 점 | 165℃ |
| 밀도 | 1.320 |
| 인화점 | 63℃ |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| pKa(산도 계수) | 8.16±0.10(Predicted) |
| 물리적 상태 | 액체 |
| 색상 | 무색 |
| 용해도 | 물(1.2g/L)(25°C)에 약간 용해됩니다. |
| 안정성 | 공기에 민감한 |
| InChI | InChI=1S/C7H6F3N/c8-4-1-6(9)5(3-11)7(10)2-4/h1-2H,3,11H2 |
| InChIKey | RCHOKTKXVKKNBC-UHFFFAOYSA-N |
| SMILES | C1(CN)=C(F)C=C(F)C=C1F |
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 운송 번호(UN) | UN2735 |
| 관세 코드 | 2921490090 |
| 위험 문구(R) | 34 |
| 위험 표시 | Xi,C |
| 안전 문구(S) | 20-26-36/37/39-45 |
| 포장분류 | III |
| 위험 등급 | 8 |
| 위험 참고 사항 | Irritant |
용도
용도
Used to prepare dyes. Industrially used in natural gas and refinery process streams. They also are used in polymer industry as monomers. Amines find use as additives for lubricating oils, engine fuels, and asphalt, and are producers of ethanolamines.