Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,4,5-Trifluorobenzyl Bromide
1-(BROMOMETHYL)-2,4,5-TRIFLUOROBENZENE · 2,4,5-Trifluorobenzy · 1-(Bromomethyl)-2,4,5-trifluorobenzene, alpha-Bromo-2,4,5-trifluorotoluene · CAS:157911-56-3 · 5-Trifluorobenzyl broMide · 2,4,5-TRIFLUOROBENZYL BROMIDE · à-bromo-2,4,5-trifluorotoluene · 2,4,5-Trifluorobenzylbromide97%
식별자 및 물리적 특성
| CAS No. | 157911-56-3 |
|---|---|
| 분자식 | C7H4BrF3 |
| 평균 분자량 | 225.01 g/mol |
| 단동위원소 질량 | 223.94484689 g/mol |
| SMILES | Fc1cc(F)c(CBr)cc1F |
| InChIKey | GAUXEYCSWSMMFZ-UHFFFAOYSA-N |
| PubChem CID | 2777057 |
| EC No. | 642-693-8 |
| DTXSID | DTXSID60380355 |
화학 및 물리적 성질
| XLogP | 2.8 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 131 |
| 끓는 점 | 188.8±35.0 °C(Predicted) |
| 밀도 | 1.71 |
| 굴절률 | 1.5015 |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색~연황색 |
| 비중 | 1.71 |
| BRN | 8312091 |
| InChI | InChI=1S/C7H4BrF3/c8-3-4-1-6(10)7(11)2-5(4)9/h1-2H,3H2 |
| InChIKey | GAUXEYCSWSMMFZ-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC(F)=C(F)C=C1F |
화학적 성질
White low melting solid
안전 및 규제
| GHS 분류 | DangerH290 (14.3%): May be corrosive to metals [Warning Corrosive to Metals]P234, P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P337+P317, P363, P390, P403+P233, P405, P406, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 7 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Met. Corr. 1 (14.3%) |
| TSCA 등재 상태 | T |
| 운송 번호(UN) | 1760 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 34-36-25 |
| 위험 표시 | C,T |
| 안전 문구(S) | 26-36/37/39-45-23-20 |
| 포장분류 | II |
| 위험 등급 | 8 |
| 위험 참고 사항 | Corrosive/Lachrymatory |