Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-Chloro-6-(trifluoromethyl)pyridazine
3-Chloro-6-(trifluoromethyl)pyridazine · Compound T9175 · 3-Chloro-6-(trifluoromethyl)-1,2-diazine · Pyridazine, 3-chloro-6-(trifluoroMethyl)- · 3-Chloro-6-trifluoromethyl-pyridazine ISO 9001：2015 REACH
식별자 및 물리적 특성
| CAS No. | 258506-68-2 |
|---|---|
| 분자식 | C5H2ClF3N2 |
| 평균 분자량 | 182.53 g/mol |
| 단동위원소 질량 | 181.9858604 g/mol |
| SMILES | FC(F)(F)c1ccc(Cl)nn1 |
| InChIKey | AZNKQIFEMQHORS-UHFFFAOYSA-N |
| PubChem CID | 28242526 |
| EC No. | 674-925-9 |
| DTXSID | DTXSID50651187 |
화학 및 물리적 성질
| XLogP | 1.7 |
|---|---|
| 극성 표면적 | 25.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 138 |
| 녹는점 | 55-59°C |
| 끓는 점 | 233.3±35.0 °C(Predicted) |
| 밀도 | 1.504 |
| 인화점 | 95℃ |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| pKa(산도 계수) | -1.53±0.10(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 연노랑 |
| InChI | InChI=1S/C5H2ClF3N2/c6-4-2-1-3(10-11-4)5(7,8)9/h1-2H |
| InChIKey | AZNKQIFEMQHORS-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NN=C(C(F)(F)F)C=C1 |
화학적 성질
White crystalline powder
안전 및 규제
| GHS 분류 | DangerH301 (92.9%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P316, P302+P352, P305+P351+P338, P321, P330, P332+P317, P337+P317, P362+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (92.9%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 2811 |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 25-36/38 |
| 위험 표시 | T |
| 안전 문구(S) | 26-45-24/25 |
| 포장분류 | Ⅲ |
| 위험 등급 | 6.1Acute Tox. 3 OralEye Irrit. 2Skin Irrit. 2 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
3-Chloro-6-(trifluoromethyl)pyridazine is a general reagent for use in the repositioning of antitubercular oxazoles for certain neglected tropical diseases.