Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 2829359생성일: 2026년 11월 2일
Ethyl 4-(3,4-dimethoxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
ethyl 4-(3,4-dimethoxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,5,6,7,8-hexahydro-3-quinolinecarboxylate · 3-Quinolinecarboxylic acid, 4-(3,4-dimethoxyphenyl)-1,4,5,6,7,8-hexahydro-2,7,7-trimethyl-5-oxo-, ethyl ester
https://huagongshe.com/ko/chemical/2829359
식별자 및 물리적 특성
| CAS No. | 292853-30-6 |
|---|
| 분자식 | C23H29NO5 |
|---|
| 평균 분자량 | 399.5 g/mol |
|---|
| 단동위원소 질량 | 399.20457303 g/mol |
|---|
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)CC(C)(C)C2)C1c1ccc(OC)c(OC)c1 |
|---|
| InChIKey | AGYGSGDDSUUXGN-UHFFFAOYSA-N |
|---|
| PubChem CID | 2829359 |
|---|
| EC No. | 151-877-2 |
|---|
화학 및 물리적 성질
| XLogP | 3.6 |
|---|
| 극성 표면적 | 73.9 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 6 |
|---|
| 회전 가능 결합 수 | 6 |
|---|
| 무거운 원자 수 | 29 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 736 |
|---|
| 녹는점 | 198-199 °C(Solv: ethanol (64-17-5)) |
|---|
| 끓는 점 | 528.5±50.0 °C(Predicted) |
|---|
| 밀도 | 1.18±0.1 g/cm3(Predicted) |
|---|
| pKa(산도 계수) | 1.29±0.70(Predicted) |
|---|
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
|---|
