Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Methoxy-2-nitrobenzonitrile
4-Methoxy-2-nitrobenzonitrile · 2-nitro-4-Methoxybenzonitrile · Benzonitrile, 4-methoxy-2-nitro- · 4-METHOXY-2-NITROBENZONITRILE ISO 9001：2015 REACH
식별자 및 물리적 특성
| CAS No. | 38469-83-9 |
|---|---|
| 분자식 | C8H6N2O3 |
| 평균 분자량 | 178.14 g/mol |
| 단동위원소 질량 | 178.03784205 g/mol |
| SMILES | COc1ccc(C#N)c([N+](=O)[O-])c1 |
| InChIKey | UUYPUFCWSUBTFP-UHFFFAOYSA-N |
| PubChem CID | 288665 |
| EC No. | 627-718-2 |
| DTXSID | DTXSID30302281 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 78.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 240 |
| 녹는점 | 137-140 °C(lit.) |
| 끓는 점 | 364.5±27.0 °C(Predicted) |
| 밀도 | 1.32±0.1 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 결정성 분말 |
| 색상 | 흰색에서 베이지색 |
| InChI | 1S/C8H6N2O3/c1-13-7-3-2-6(5-9)8(4-7)10(11)12/h2-4H,1H3 |
| InChIKey | UUYPUFCWSUBTFP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C#N)c(c1)[N+]([O-])=O |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29269090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Methoxy-2-nitrobenzonitrile may be used to synthesize, 4-methoxy-N′-(4-methoxyphenyl)-2-nitrobenzene-1-carboximidamideby heating with p-anisidine and trimethylaluminium in toluene.
일반 설명
4-Methoxy-2-nitrobenzonitrile can be prepared by reacting 3-nitro-4-bromoanisole with cuprous cyanide in dimethylformamide.