1-Ethynyl-10a,12a-dimethyl-2,3,3a,3b,4,5,10,10a,10b,11,12,12a-dodecahydro-1H-cyclopenta(7,8)phenanthro(3,2-d)(1,2)oxazol-1-ol
danazole · danocrine · Danazol Usp · 17α-Pregna-2,4-dien-20-yne-[2,3-d]isoxazole-17b-ol · 4-ANDROSTEN-[2,3-D]ISOXAZOLE-17-ALPHA-ETHYNYL-17-BETA-OL · 1H-Cyclopenta[7,8]phenanthro[3,2-d]isoxazol-1-ol, 1-ethynyl-2,3,3a,3b,4,5,10,10a,10b,11,12,12a-dodecahydro-10a,12a-dimethyl- (7CI) · Dano · danol
식별자 및 물리적 특성
| CAS No. | 17230-88-5 |
|---|---|
| 분자식 | C22H27NO2 |
| 평균 분자량 | 337.5 g/mol |
| 단동위원소 질량 | 337.2041791 g/mol |
| SMILES | C#CC1(O)CCC2C3CCC4=Cc5oncc5CC4(C)C3CCC21C |
| InChIKey | POZRVZJJTULAOH-UHFFFAOYSA-N |
| PubChem CID | 2949 |
| ChEBI | CHEBI:91575 |
| DTXSID | DTXSID80860200 |
화학 및 물리적 성질
| XLogP | 3.8 |
|---|---|
| 극성 표면적 | 46.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 25 |
| 형식 전하 | 0 |
| 복잡도 | 677 |
| 녹는점 | 224.4-226.80C |
| 끓는 점 | 473.76°C (rough estimate) |
| 밀도 | 1.0909 (rough estimate) |
| 굴절률 | 1.5614 (estimate) |
| 저장 조건 | -20°C Freezer |
| 용해도 | Acetonitrile (Slightly), Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| pKa(산도 계수) | 13.10±0.60(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 흰색에서 연한 노란색 |
| 용해도 | 물에 부분적으로 용해됩니다. 클로로포름(25 mg/ml), 아세톤, 아세토니트릴 및 에탄올에 용해됩니다. |
| InChI | 1S/C22H27NO2/c1-4-22(24)10-8-18-16-6-5-15-11-19-14(13-23-25-19)12-20(15,2)17(16)7-9-21(18,22)3/h1,11,13,16-18,24H,5-10,12H2,2-3H3/t16,17,18,20,21,22-/m0/s1 |
| InChIKey | POZRVZJJTULAOH-QLPJIZEUNA-N |
| SMILES | [C@]12([H])CC[C@]3(C)[C@](CC[C@@]3([H])[C@]1([H])CCC1=CC3ON=CC=3C[C@]21C)(O)C#C |&1:0,4,6,9,11,23,r| |
| EPA | Danazol (17230-88-5) |
화학적 성질
White Solid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | TU4157070 |
| 독성 | dog,LD50,oral,> 5gm/kg (5000mg/kg),Journal of International Medical Research. Vol. 5(Suppl, |
| 관세 코드 | 29372900 |
| 위험 문구(R) | 20/21/22-63-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 22-36-37/39-26 |
| 위험 등급 | Acute Tox. 4 DermalAcute Tox. 4 InhalationRepr. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Danazol is an anterior pituitary supressant. Danazol is an anabolic steroid derivative of ethisterone, with mild androgenic side effects (an impeded androgen). Antigonadotropin.
일반 설명
Danazol, 17α-pregna-2,4-dien-20-yno-[2,3-d]isoxazol-17-ol, is a weak androgen that, in spite ofthe 17α-ethinyl group, has little estrogenic or progestogenicactivity. Danazol has been called a synthetic steroidwith diverse biological effects. Danazol binds to sexhormone–binding globulin (SHBG) and decreases the hepaticsynthesis of this estradiol and testosterone carrier.Free testosterone thus increases. Danazol inhibits FSH andLH production by the hypothalamus and pituitary. It bindsto PRs, GRs, ARs, and ERs. Although the exact mechanismof action is unclear, danazol alters endometrial tissueso that it becomes inactive and atrophic, which allowsdanazol to be an effective treatment for endometriosis.Danazol is also used to treat hereditary angioedema and fibrocysticbreast disease.