Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 3049생성일: 2026년 11월 2일
Phenol, 4,4'-(1,2-diethylidene-1,2-ethanediyl)bis-
[2H4]-Dienestrol · Dienestrol-3′,3",5′,5"-d4 · 2,4-Dichlorobenzyl Alcohol Impurity 17 · 3,4-Bis(hydroxyphenyl)-2,4-hexadiene-d4 · Z,Z-Dienestrol-d4 DISCONTINUED, offer D448817 or D441818
https://huagongshe.com/ko/chemical/3049
식별자 및 물리적 특성
| CAS No. | 1313738-05-4 |
|---|
| 분자식 | C18H18O2 |
|---|
| 평균 분자량 | 266.3 g/mol |
|---|
| 단동위원소 질량 | 266.13067981 g/mol |
|---|
| SMILES | CC=C(C(=CC)c1ccc(O)cc1)c1ccc(O)cc1 |
|---|
| InChIKey | NFDFQCUYFHCNBW-UHFFFAOYSA-N |
|---|
| PubChem CID | 3049 |
|---|
| ChEMBL | CHEMBL3188448 |
|---|
| EC No. | 694-647-1 |
|---|
| DTXSID | DTXSID7022382 |
|---|
화학 및 물리적 성질
| XLogP | 5.4 |
|---|
| 극성 표면적 | 40.5 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 2 |
|---|
| 회전 가능 결합 수 | 3 |
|---|
| 무거운 원자 수 | 20 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 318 |
|---|
| SpringerMaterials Properties | Angular frequency |
|---|
| LogP(분배 계수) | 5.9 |
|---|
| 용해도 | 1.23e-02 g/L |
|---|
| Endocrine Disruptors | Potential endocrine disrupting compound |
|---|
| 녹는점 | 227.5 °C |
|---|
| Physical Description | Solid |
|---|
| 물리적 상태 | solid |
|---|
| InChI | 1S/C18H18O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h3-12,19-20H,1-2H3/b17-3+,18-4+/i9D,10D,11D,12D |
|---|
| InChIKey | NFDFQCUYFHCNBW-XTALISAZSA-N |
|---|
| SMILES | [2H]c1cc(cc([2H])c1O)C(=C/C)\C(=C\C)c2cc([2H])c(O)c([2H])c2 |
|---|
안전 및 규제
| GHS 분류 | DangerH350 (100%): May cause cancer [Danger Carcinogenicity]P203, P280, P318, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Carc. 1B (100%) |
|---|
| 수질 위해 등급(WGK) | WGK 3 |
|---|
| 위험 문구(R) | 45-62 |
|---|
| 위험 표시 | T |
|---|
| 안전 문구(S) | 53-36/37-45 |
|---|
| 위험 등급 | Carc. 1BRepr. 2 |
|---|
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
|---|
