Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Diethyl P-((4-methylphenyl)methyl)phosphonate
LABOTEST-BB LT01148271 · Diethyl p-tolylmethylphosphonate · DIETHYL 4-METHYLBENZYLPHOSPHONATE · diethyl-(4-methylbenzyl)phosphonat · DIETHYL (P-METHYLBENZYL)PHOSPHONATE · Diethyl(4-Methylbenzyl)phosphonate>Diethyl-4-methylbenzylphosphonate 97% · Diethyl 4-methylbenzylphosphonate, 98+% · 4-methylphenylphosphoric acidiethyl ester
식별자 및 물리적 특성
| CAS No. | 3762-25-2 |
|---|---|
| 분자식 | C12H19O3P |
| 평균 분자량 | 242.25 g/mol |
| 단동위원소 질량 | 242.1071811 g/mol |
| SMILES | CCOP(=O)(Cc1ccc(C)cc1)OCC |
| InChIKey | QKGBKPZAXXBLJE-UHFFFAOYSA-N |
| PubChem CID | 3050 |
| EC No. | 223-180-4 |
| DTXSID | DTXSID30191056 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 35.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 224 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| 끓는 점 | 110 °C/0.2 mmHg (lit.) |
| 밀도 | 1.07 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.497(lit.) |
| 인화점 | 230 °F |
| 저장 조건 | Storage temp. 2-8°C |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색 내지 거의 무색 |
| BRN | 2940626 |
| InChI | InChI=1S/C12H19O3P/c1-4-14-16(13,15-5-2)10-12-8-6-11(3)7-9-12/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | QKGBKPZAXXBLJE-UHFFFAOYSA-N |
| SMILES | P(CC1=CC=C(C)C=C1)(=O)(OCC)OCC |
화학적 성질
clear colorless liquid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| 관세 코드 | 29319000 |
| 위험 문구(R) | 36/37/38 |
| 안전 문구(S) | 24/25 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
Reactant involved in:Synthesis of stilbenes via oxidation and Horner-Emmons reactionsIntramolecular cyclization of aryl ethers, amines, and amidesStudies of the effects of functional groups on the performance of blue organic LEDsOlefination reactionsPreparation of antimalarial agents