Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 3118317생성일: 2026년 10월 30일
2-({[3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropyl]carbonyl}amino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
https://huagongshe.com/ko/chemical/3118317
식별자 및 물리적 특성
| CAS No. | 297146-34-0 |
|---|
| 분자식 | C17H20Cl2N2O2S |
|---|
| 평균 분자량 | 387.3 g/mol |
|---|
| 단동위원소 질량 | 386.0622544 g/mol |
|---|
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)Nc1sc2c(c1C(N)=O)CCCC2 |
|---|
| InChIKey | AYKAFPCYVLBBNK-UHFFFAOYSA-N |
|---|
| PubChem CID | 3118317 |
|---|
| EC No. | 169-067-2 |
|---|
화학 및 물리적 성질
| XLogP | 4.7 |
|---|
| 극성 표면적 | 100 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 3 |
|---|
| 회전 가능 결합 수 | 4 |
|---|
| 무거운 원자 수 | 24 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 577 |
|---|
안전 및 규제
| GHS 분류 | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P264+P265, P273, P280, P305+P351+P338, P337+P317, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Eye Irrit. 2 (100%) |
|---|
![2-({[3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropyl]carbonyl}amino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide 분자 구조식](/img/chemical/3118317.png)