식별자 및 물리적 특성
| CAS No. | 122-32-7 |
|---|
| 분자식 | C57H104O6 |
|---|
| 평균 분자량 | 885.4 g/mol |
|---|
| 단동위원소 질량 | 884.78329105 g/mol |
|---|
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC |
|---|
| InChIKey | PHYFQTYBJUILEZ-UHFFFAOYSA-N |
|---|
| PubChem CID | 31207 |
|---|
| EC No. | 609-955-3 |
|---|
| DTXSID | DTXSID70859229 |
|---|
| 현지명 | 트리올레인 |
|---|
화학 및 물리적 성질
| XLogP | 22.4 |
|---|
| 극성 표면적 | 78.9 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 6 |
|---|
| 회전 가능 결합 수 | 53 |
|---|
| 무거운 원자 수 | 63 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 1,010 |
|---|
| Physical Description | Liquid |
|---|
안전 및 규제
| 규제 정보 | 9-Octadecenoic acid (9Z)-, 1,1',1''-(1,2,3-propanetriyl) ester is listed on the EPA's Chemical Data Reporting (CDR) system. Manufacturers and importers of 9-Octadecenoic acid (9Z)-, 1,1',1''-(1,2,3-propanetriyl) ester are required to report information about their production and use of this chemical to the EPA under the Toxic Substances Control Act (TSCA). (40 eCFR Part 711) |
|---|
| EPA Safer Chemical | Chemical: Glyceryl trioleate |
|---|
