Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N, N- 디벤질에틸렌 디암무늄 디 (아세트산)
N,N-디벤질에틸렌디암무늄디(아세트산) · N,N'-디벤질에틸렌디아민디아세테이트 · N,N-DIBENZYLETHYLENEDIAMINE DIACETATE · DBED-ACETATE · dbeddiacetate · Benzylpenicillin Impurity 22 · 1-butyl-3-pyrrolidinecarboxylate · N,N-DibenzylethyleneDiamineAcetate
식별자 및 물리적 특성
| CAS No. | 122-75-8 |
|---|---|
| 분자식 | C16H20N2.2C2H4O2 |
| 평균 분자량 | 360.4 g/mol |
| 단동위원소 질량 | 360.20490738 g/mol |
| SMILES | CC(=O)O.CC(=O)O.c1ccc(CNCCNCc2ccccc2)cc1 |
| InChIKey | MTRNNCLQPVCDLF-UHFFFAOYSA-N |
| PubChem CID | 31228 |
| EC No. | 204-572-4 |
| DTXSID | DTXSID40883314 |
| 현지명 | N, N- 디벤질에틸렌 디암무늄 디 (아세트산) |
화학 및 물리적 성질
| 극성 표면적 | 98.7 |
|---|---|
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 7 |
| 무거운 원자 수 | 26 |
| 형식 전하 | 0 |
| 복잡도 | 202 |
| 녹는점 | 117-118°C |
| 저장 조건 | Store below +30°C. |
| 용해도 | 물에 용해됨 |
| 용해도 | 클로로포름(약간), 아세트산에틸(약간), 물(약간)에 용해됨 |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 거의 흰색 |
| pH | 5-6 (50g/l, H2O, 20°C) |
| Merck | 14,1064 |
| BRN | 3781362 |
| InChI | InChI=1S/C16H20N2.2C2H4O2/c1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-162*1-2(3)4/h1-10,17-18H,11-14H22*1H3,(H,3,4) |
| InChIKey | MTRNNCLQPVCDLF-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)CNCCNCC1=CC=CC=C1.C(=O)(O)C.C(=O)(O)C |
| EPA | N,N'-Dibenzyl ethylenediamine diacetate (122-75-8) |
화학적 성질
White needle crystal
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 65 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Chemical: 1,2-Ethanediamine, N,N'-bis(phenylmethyl)-, diacetateStatus: Active Update: 29-04-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/127151,2-Ethanediamine, N,N'-bis(phenylmethyl)-, diacetate: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | WGK 3 highly water endangering |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | KV3400000 |
| 관세 코드 | 2921 59 90 |
| 위험 문구(R) | 22-43 |
| 안전 문구(S) | 36/37 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
N,N''-Dibenzylethylenediamine is currently being investigated as a potential hepatitis C virus inhibitor. N,N''-dibenzylethylenediamine and its derivatives are also inhibitors of cholesterol biosynthesis.