Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,3-Dimethoxy-1,4-naphthoquinone
DMNQ · DIMENQ · Nsc 69355 · DMNQ, 10 mM in DMSO · RARECHEM BW GA 0209 · 2,3-DIMETHOXY-1,4-NAPHTHOQUINONE · 2,3-Dimethoxy-1,4-naphthalenedione · 2,3-dimethoxynaphthalene-1,4-dione
식별자 및 물리적 특성
| CAS No. | 6956-96-3 |
|---|---|
| 분자식 | C12H10O4 |
| 평균 분자량 | 218.2 g/mol |
| 단동위원소 질량 | 218.0579088 g/mol |
| SMILES | COC1=C(OC)C(=O)c2ccccc2C1=O |
| InChIKey | ZEGDFCCYTFPECB-UHFFFAOYSA-N |
| PubChem CID | 3136 |
| ChEMBL | CHEMBL402468 |
| ChEBI | CHEBI:64215 |
| EC No. | 636-211-5 |
| DTXSID | DTXSID8040935 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 52.6 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 322 |
| 저장 조건 | -20°C |
| 용해도 | DMSO(최대 10mg/ml) 또는 에탄올(최대 5mg/ml)에 용해됩니다. |
| 물리적 상태 | 고체 |
| 색상 | 노란색 |
| 안정성 | 공급된 대로 1년 동안 안정적입니다. DMSO의 솔루션은 -20°에서 최대 3개월 동안 보관할 수 있습니다. |
| InChI | 1S/C12H10O4/c1-15-11-9(13)7-5-3-4-6-8(7)10(14)12(11)16-2/h3-6H,1-2H3 |
| InChIKey | ZEGDFCCYTFPECB-UHFFFAOYSA-N |
| SMILES | COC1=C(OC)C(=O)c2ccccc2C1=O |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
DMNQ is a 1,4-naphthoquinone that acts as a redox-cycling agent, typically increasing intracellular superoxide and hydrogen peroxide formation. The amount of oxidative stress is proportional to the amount of DMNQ applied and can alter diverse cellular parameters, including signal transduction, mitochondrial function, and gene expression.
용도
DMNQ is a non-alkylating redox cycling quinone.