Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Cytosine arabinoside monophosphate
Polycytidylic acid · Poly(CMP) · Poly(C) (>90%) · PolyinsoinicAcid · Poly C-Na，poly C · Polyribocytidylic acid · Poly(5'-cytidylic acid) · POLYCYTIDYLIC ACID (5'polyribonucleotidecomplexc
식별자 및 물리적 특성
| CAS No. | 30811-80-4 |
|---|---|
| 분자식 | C9H14N3O8P |
| 평균 분자량 | 323.2 g/mol |
| 단동위원소 질량 | 323.05185141 g/mol |
| SMILES | Nc1ccn(C2OC(COP(=O)(O)O)C(O)C2O)c(=O)n1 |
| InChIKey | IERHLVCPSMICTF-UHFFFAOYSA-N |
| PubChem CID | 314 |
| ChEMBL | CHEMBL296272 |
| ChEBI | CHEBI:181445 |
| DTXSID | DTXSID70861605 |
화학 및 물리적 성질
| XLogP | -3.4 |
|---|---|
| 극성 표면적 | 175 |
| 수소 결합 공여자 수 | 5 |
| 수소 결합 수용자 수 | 8 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 531 |
| 녹는점 | 69℃ |
| 저장 조건 | Refrigerator |
| 용해도 | 메탄올(아주 약간 용해됨), 물 |
| 물리적 상태 | 고체 |
| 색상 | 흰색에서 황백색까지 |
| InChI | InChI=1/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/s3 |
| InChIKey | IERHLVCPSMICTF-IKRYCBPCNA-N |
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(O)=O)O[C@H]1N1C=CC(N)=NC1=O)O |&1:1,2,3,11,r| |
용도
용도
Poly(C), is a cytidine polymer used vastly in studies such as in the study of role of the external NH2 linker on the conformation of surface immobilized single strand DNA probes and their SERS detection, that can be very important for the performances of devices such as biosensors.