Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
드로페닌
드로페닌 · Adiphenine H · Trasentin-6H · Cycloadiphene · AGJBLWCLQCKRJP-UHFFFAOYSA-N · 2-(DiethylaMino)ethyl 2-cyclohexyl-2-phenylacetate · α-Cyclohexylbenzeneacetic acid 2-(diethylamino)ethyl ester · Benzeneacetic acid, α-cyclohexyl-, 2-(diethylamino)ethyl ester
식별자 및 물리적 특성
| CAS No. | 1679-76-1 |
|---|---|
| 분자식 | C20H31NO2 |
| 평균 분자량 | 317.5 g/mol |
| 단동위원소 질량 | 317.23547923 g/mol |
| SMILES | CCN(CC)CCOC(=O)C(c1ccccc1)C1CCCCC1 |
| InChIKey | AGJBLWCLQCKRJP-UHFFFAOYSA-N |
| PubChem CID | 3166 |
| ChEMBL | CHEMBL442444 |
| ChEBI | CHEBI:93825 |
| EC No. | 605-497-3 |
| DTXSID | DTXSID0048472 |
| 현지명 | 드로페닌 |
화학 및 물리적 성질
| XLogP | 5.3 |
|---|---|
| 극성 표면적 | 29.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 9 |
| 무거운 원자 수 | 23 |
| 형식 전하 | 0 |
| 복잡도 | 329 |
| 의약품 | Pharmaceutical |
| Human Drugs | Pharmaceuticals |
| Collision Cross Section | 175.92 Ų [M+K]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
| 끓는 점 | bp0.15 158° |
| 밀도 | 1.0047 g/cm3 |
| pKa(산도 계수) | 9.21±0.25(Predicted) |