Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Chloro-6-hydrazinopyridine
2-CHLOROPYRIDINEHYDRAZINE · 2-Chloro-6hydrazine pyridine · 2-Chloro-6-hydrazinopyridine · 2-Chloro-6-hydrazinylpyridine · 6-CHLOROPYRIDIN-2-YLHYDRAZINE · (6-Chloro-2-pyridyl)hydrazine · 6-Chloropyridine-2-ylhydrazine · Pyridine, 2-chloro-6-hydrazinyl-
식별자 및 물리적 특성
| CAS No. | 5193-03-3 |
|---|---|
| 분자식 | C5H6ClN3 |
| 평균 분자량 | 143.57 g/mol |
| 단동위원소 질량 | 143.02502487 g/mol |
| SMILES | NNc1cccc(Cl)n1 |
| InChIKey | HFTSPKIAXHZROA-UHFFFAOYSA-N |
| PubChem CID | 320004 |
| EC No. | 678-881-1 |
| DTXSID | DTXSID50313076 |
화학 및 물리적 성질
| XLogP | 1.4 |
|---|---|
| 극성 표면적 | 50.9 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 88.3 |
| 녹는점 | 118°C |
| 끓는 점 | 118°C |
| 밀도 | 1.43±0.1 g/cm3(Predicted) |
| 인화점 | 117-120°C |
| 저장 조건 | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 9.08±0.70(Predicted) |
| 색상 | 밝은 노란색에서 갈색까지 |
| InChI | InChI=1S/C5H6ClN3/c6-4-2-1-3-5(8-4)9-7/h1-3H,7H2,(H,8,9) |
| InChIKey | HFTSPKIAXHZROA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(NN)=CC=C1 |
안전 및 규제
| GHS 분류 | DangerH301 (22.2%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P262, P264, P264+P265, P270, P271, P280, P301+P316, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P330, P332+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 9 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (22.2%) |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 20/21/22-36/37/38-41-25 |
| 위험 표시 | Xi,T |
| 안전 문구(S) | 26-36/37/39-39-45-36 |
| 포장분류 | III |
| 위험 등급 | IRRITANT |
용도
용도
2-Chloro-6-hydrazinopyridine is used as a useful research chemical.