Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Bromo-4'-(trifluoromethyl)acetophenone
2-broMo-1-(4-(trifluoroMethyl)phenyl)ethanone · 2-BroMo-4&priMe · BUTTPARK 35\01-55 · methyl 3-cyano-5-nitrobenzoate · 4-TRIFLUOROMETHYLPHENACYL BROMIDE · 4-(Trifluoromethyl)phecyl bromide · 4'-(TRIFLUOROMETHYL)PHENACYL BROMIDE · 4-(Trifluoromethyl)phenacylbromide97%
식별자 및 물리적 특성
| CAS No. | 383-53-9 |
|---|---|
| 분자식 | C9H6BrF3O |
| 평균 분자량 | 267.04 g/mol |
| 단동위원소 질량 | 265.95541157 g/mol |
| SMILES | O=C(CBr)c1ccc(C(F)(F)F)cc1 |
| InChIKey | HEMROKPXTCOASZ-UHFFFAOYSA-N |
| PubChem CID | 321979 |
| ChEMBL | CHEMBL105348 |
| EC No. | 609-544-9 |
| DTXSID | DTXSID30313791 |
화학 및 물리적 성질
| XLogP | 3.3 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 207 |
| 녹는점 | 45 °C |
| 끓는 점 | 264.2±40.0 °C(Predicted) |
| 밀도 | 1.592±0.06 g/cm3(Predicted) |
| 저장 조건 | 2-8°C |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 노란색, 주황색으로 |
| InChI | 1S/C9H6BrF3O/c10-5-8(14)6-1-3-7(4-2-6)9(11,12)13/h1-4H,5H2 |
| InChIKey | HEMROKPXTCOASZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(cc1)C(=O)CBr |
화학적 성질
White powder or crystal
안전 및 규제
| GHS 분류 | WarningH315 (92.9%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (92.9%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 1759 |
| 관세 코드 | 29147000 |
| 위험 문구(R) | 34-36/37/38 |
| 위험 표시 | C,Xi |
| 안전 문구(S) | 26-36/37/39-45-36 |
| 포장분류 | III |
| 위험 등급 | CORROSIVEEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |