Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,4,5-트리메톡시아닐린
3,4,5-트리메톡시아닐린 · 3,4,5-Trimethoxy · 3,4,5-trimethoxy-benzenamin · 3,4,5-triMethoxybenzenaMine · NSC 37006 · TriMethoxyaniline · 5-Trimethoxyaniline · 3,4,5-TrimethoxyaniL
식별자 및 물리적 특성
| CAS No. | 24313-88-0 |
|---|---|
| 분자식 | C9H13NO3 |
| 평균 분자량 | 183.2 g/mol |
| 단동위원소 질량 | 183.08954328 g/mol |
| SMILES | COc1cc(N)cc(OC)c1OC |
| InChIKey | XEFRNCLPPFDWAC-UHFFFAOYSA-N |
| PubChem CID | 32285 |
| ChEMBL | CHEMBL3814177 |
| EC No. | 246-154-4 |
| DTXSID | DTXSID8066979 |
| 현지명 | 3,4,5-트리메톡시아닐린 |
화학 및 물리적 성질
| XLogP | 0.8 |
|---|---|
| 극성 표면적 | 53.7 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 140 |
| 녹는점 | 110-113 °C (lit.) |
| 끓는 점 | 316.88°C (rough estimate) |
| 밀도 | 1.1967 (rough estimate) |
| 굴절률 | 1.4760 (estimate) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| pKa(산도 계수) | 4.35±0.10(Predicted) |
| 물리적 상태 | 가루 |
| 색상 | 미색에서 베이지색 갈색, 회색 또는 분홍색 |
| BRN | 642919 |
| InChI | InChI=1S/C9H13NO3/c1-11-7-4-6(10)5-8(12-2)9(7)13-3/h4-5H,10H2,1-3H3 |
| InChIKey | XEFRNCLPPFDWAC-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(OC)=C(OC)C(OC)=C1 |
| EPA | 3,4,5-Trimethoxyaniline (24313-88-0) |
화학적 성질
3,4,5-Trimethoxyaniline is off-white to beige-brown, grey or pink powder
안전 및 규제
| GHS 분류 | WarningH302 (14.3%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (14.3%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | 2811 |
| 관세 코드 | 29222900 |
| 위험 문구(R) | 37/38-36/37/38-20/21/22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 22-24/25-37/39-26-24-36 |
| 포장분류 | III |
| 위험 등급 | 6.1Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Harmful |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3,4,5-Trimethoxyaniline is a tri-substituted aniline derivative with sympatholytic activity. It is used in the preparation of a novel class of anticancer agents.