Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
노나플루오로-1-부탄설포닐염화물
노나플루오로-1-부탄설포닐염화물 · 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonyl chloride · NONAFLUOROBUTANESULFONYL CHLORIDE · NSC 292150 · Perfluorobutylsulfonyl chloride · Perfluorobutyl xanthyl chloride · Perfluorobutanesulfonyl chloride · PERFLUOROBUTANESULPHONYL CHLORIDE
식별자 및 물리적 특성
| CAS No. | 2991-84-6 |
|---|---|
| 분자식 | C4ClF9O2S |
| 평균 분자량 | 318.55 g/mol |
| 단동위원소 질량 | 317.9163819 g/mol |
| SMILES | O=S(=O)(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChIKey | IRFCLLARAUQTNK-UHFFFAOYSA-N |
| PubChem CID | 324955 |
| EC No. | 626-978-4 |
| DTXSID | DTXSID80315129 |
| 현지명 | 노나플루오로-1-부탄설포닐염화물 |
화학 및 물리적 성질
| XLogP | 3.6 |
|---|---|
| 극성 표면적 | 42.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 11 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 17 |
| 형식 전하 | 0 |
| 복잡도 | 390 |
| PFAS | PFAS -> Other/unspecifiedPFAS -> OECD Category |
| 끓는 점 | 100.5-103.5℃ |
| 밀도 | 1.807±0.06 g/cm3(Predicted) |
| 저장 조건 | 2-8°C, stored under nitrogen, away from moisture |
| 물리적 상태 | 액체 |
| 색상 | Clear, colourless |
| InChI | InChI=1S/C4ClF9O2S/c5-17(15,16)4(13,14)2(8,9)1(6,7)3(10,11)12 |
| InChIKey | IRFCLLARAUQTNK-UHFFFAOYSA-N |
| SMILES | C(F)(F)(S(Cl)(=O)=O)C(F)(F)C(F)(F)C(F)(F)F |
| EPA | Perfluoro-1-butanesulfonyl chloride (2991-84-6) |
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3265 8/PG 2 |
| 관세 코드 | 2904990090 |
| 위험 문구(R) | 34 |
| 위험 표시 | C,Xi |
| 안전 문구(S) | 26-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 8Skin Corr. 1B |
| F 고인화성물질 | 10-21 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
Nonafluoro-1-butanesulfonyl chloride is a raw chemical that can be used as a reagent for organic synthesis or fluorescent labelling of nucleophilic reagents.