Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
에버트린
에버트린 · ethaverine · Drotaverine Impurity 6 · Drotaverine Impurity 3 (Ethaverine) · Impurity K of Qutaweilin Hydrochloride · 1-(3,4-diethoxybenzyl)-6,7-diethoxyisoquinoline · 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxyisoquinoline · Ethaverine/1-(3,4-Diethoxybenzyl)-6,7-diethoxyisoquinoline
식별자 및 물리적 특성
| CAS No. | 486-47-5 |
|---|---|
| 분자식 | C24H29NO4 |
| 평균 분자량 | 395.5 g/mol |
| 단동위원소 질량 | 395.20965841 g/mol |
| SMILES | CCOc1ccc(Cc2nccc3cc(OCC)c(OCC)cc23)cc1OCC |
| InChIKey | ZOWYFYXTIWQBEP-UHFFFAOYSA-N |
| PubChem CID | 3280 |
| ChEMBL | CHEMBL1555736 |
| ChEBI | CHEBI:94592 |
| EC No. | 207-633-3 |
| DTXSID | DTXSID3023009 |
| 현지명 | 에버트린 |
화학 및 물리적 성질
| XLogP | 5.4 |
|---|---|
| 극성 표면적 | 49.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 10 |
| 무거운 원자 수 | 29 |
| 형식 전하 | 0 |
| 복잡도 | 462 |
| Human Drugs | Pharmaceuticals |
| Collision Cross Section | 207.89 Ų [M+H]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
| 녹는점 | 99-101° |
| 끓는 점 | 519.44°C (rough estimate) |
| 밀도 | 1.1668 (rough estimate) |
| 굴절률 | 1.6000 (estimate) |
| 저장 조건 | Refrigerator |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 6.41±0.40(Predicted) |
| 색상 | 흰색에서 황백색까지 |
화학적 성질
Crystals.Insoluble in water; very soluble in hot alcohol; slightly soluble in ether and chloroform.
안전 및 규제
| 기타 안전 정보 | IMAP assessments - Isoquinoline, 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-: Human health tier I assessment |
|---|
용도
용도
Ethaverine is an analogue of Papaverine (P190500), an antispasmodic. An isoquinoline derivative with the potential for antimicrobial, antimalarial and cytotoxic antiviral agents.