6-Sulfanylhexanoic acid
6-sulfanylhexanoicaci · 6-SULFANYLHEXANOIC ACID · 5-Carboxy-1-pentanethiol · Hexanoic acid, 6-mercapto- · 6-Mercaptohexanoic acid 90% · 6-Mercaptohexanoic acid,MHA · 6-Mercaptohexanoic acid ,97% · 6-Mercaptohexanoic acid≥ 96% (assay)
식별자 및 물리적 특성
| CAS No. | 17689-17-7 |
|---|---|
| 분자식 | C6H12O2S |
| 평균 분자량 | 148.23 g/mol |
| 단동위원소 질량 | 148.05580079 g/mol |
| SMILES | O=C(O)CCCCCS |
| InChIKey | CMNQZZPAVNBESS-UHFFFAOYSA-N |
| PubChem CID | 329113 |
| ChEMBL | CHEMBL78998 |
| EC No. | 626-672-0 |
| DTXSID | DTXSID60317045 |
화학 및 물리적 성질
| XLogP | 0.6 |
|---|---|
| 극성 표면적 | 38.3 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 83.1 |
| 끓는 점 | 155-157 °C(Press: 13 Torr) |
| 밀도 | 1.0715 g/mL at 25 °C |
| 굴절률 | n20/D 1.4846 |
| 저장 조건 | -20°C |
| pKa(산도 계수) | 4.74±0.10(Predicted) |
| InChI | InChI=1S/C6H12O2S/c7-6(8)4-2-1-3-5-9/h9H,1-5H2,(H,7,8) |
| InChIKey | CMNQZZPAVNBESS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCS |
화학적 성질
Colorless to yellow liquid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3334 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
MHA can be used in the surface modification of InP quantum nanowires for their potential uage in fluorescent chemical sensors that monitor cyanide ions. MHA may also be covalently bonded with liposomes that can form a SAM on the surface of gold for use as an insect odorant receptor in biosensor based applications.
일반 설명
6-Mercaptohexanoic acid (MHA) forms a self-assembled monolayer (SAM) that is used to cap a variety of materials like gold nanoparticles (AuNPs) and indium phosphide quantum dots (InPQDs). It is majorly used in immobilizing the surface molecules, which enhance the physio-chemical and electrical properties.