Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Methyl-3-nitropyridine
3-NITROPICOLINE · 3-NITRO-2-PICOLINE · 2-Methyl-3-nitropyri · 2-METHYL-3-NITROPYRIDINE · 3-NITRO-2-METHYLPYRIDINE · 2-Methxy-3-nitropyridine · Pyridine, 2-Methyl-3-nitro- · 2-METHYL-3-NITROPYRIDINE 95%
식별자 및 물리적 특성
| CAS No. | 18699-87-1 |
|---|---|
| 분자식 | C6H6N2O2 |
| 평균 분자량 | 138.12 g/mol |
| 단동위원소 질량 | 138.04292743 g/mol |
| SMILES | Cc1ncccc1[N+](=O)[O-] |
| InChIKey | CCFGTKQIRWHYTB-UHFFFAOYSA-N |
| PubChem CID | 329360 |
| EC No. | 805-108-9 |
| DTXSID | DTXSID10317136 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 58.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 132 |
| SpringerMaterials Properties | Chemical shift |
| 녹는점 | 32-33° |
| 끓는 점 | 86°C/5mmHg(lit.) |
| 밀도 | 1.246±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | powder to lump |
| pKa(산도 계수) | 1.92±0.10(Predicted) |
| 색상 | 밝은 노란색에서 갈색까지 |
| InChI | InChI=1S/C6H6N2O2/c1-5-6(8(9)10)3-2-4-7-5/h2-4H,1H3 |
| InChIKey | CCFGTKQIRWHYTB-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=CC=C1[N+]([O-])=O |
안전 및 규제
| GHS 분류 | WarningH302+H332 (33.3%): Harmful if swallowed or if inhaled [Warning Acute toxicity, oralacute toxicity, inhalation]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (33.3%) |
| 관세 코드 | 2933399990 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |
| 위험 등급 | IRRITANT |
용도
용도
2-Methyl-3-nitropyridine is used as a starting reagent to synthesize 3-substituted-4 or 6-azaindoles, and is also used as a reagent to prepare 3-azaindolyl-4-arylmalemides (compounds that exhibit antiproliferative activity).