Fenbufen
4-([1,1'-Biphenyl]-4-yl)-4-oxobutanoic acid · bufemid · cl82204 · napanol · cinopal · Cinopol · enbufen · lederfen
식별자 및 물리적 특성
| CAS No. | 36330-85-5 |
|---|---|
| 분자식 | C16H14O3 |
| 평균 분자량 | 254.28 g/mol |
| 단동위원소 질량 | 254.09429431 g/mol |
| SMILES | O=C(O)CCC(=O)c1ccc(-c2ccccc2)cc1 |
| InChIKey | ZPAKPRAICRBAOD-UHFFFAOYSA-N |
| PubChem CID | 3335 |
| ChEMBL | CHEMBL277522 |
| ChEBI | CHEBI:31599 |
| EC No. | 252-979-0 |
| DTXSID | DTXSID9023043 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 54.4 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 310 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| LogP(분배 계수) | 2.91 |
| Human Drugs | Pharmaceuticals |
| 녹는점 | 185-187184-187 °C (lit.) |
| Collision Cross Section | 150.36 Ų [M+H-H2O]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
| 끓는 점 | 357.5°C (rough estimate) |
| 밀도 | 1.1565 (rough estimate) |
| 굴절률 | 1.5600 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | 물에는 매우 약간 용해되고, 아세톤, 에탄올(96%) 및 염화메틸렌에는 약간 용해됩니다. |
| 물리적 상태 | Solid |
| pKa(산도 계수) | pKa 4.3(H2O tundened Iundened) (Uncertain) |
| 색상 | White to off-white |
| 용해도 | 2.212mg/L(25℃) |
| Merck | 13,3990 |
| 주요 응용 | 법의학 및 독성학의약품(소분자)수의사 |
| InChI | 1S/C16H14O3/c17-15(10-11-16(18)19)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,18,19) |
| InChIKey | ZPAKPRAICRBAOD-UHFFFAOYSA-N |
| SMILES | OC(=O)CCC(=O)c1ccc(cc1)-c2ccccc2 |
| EPA | [1,1'-Biphenyl]-4-butanoic acid, .gamma.-oxo- (36330-85-5) |
화학적 성질
White Solid
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P270, P301+P316, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| 기타 안전 정보 | IMAP assessments - [1,1'-Biphenyl]-4-butanoic acid, .gamma.-oxo-: Environment tier I assessment |
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | DV1761000 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 독성 | LD50 in various strains of mice, rats (mg/kg): 795-1673, 200-720 orally506-811, 265-575 i.p. (Bolte) |
| 관세 코드 | 2918300090 |
| 위험 문구(R) | 25 |
| 위험 표시 | T |
| 안전 문구(S) | 28-45 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 3 Oral |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
개요
Fenbufen has been found to be an effective, well-tolerated drug for the treatment of rheumatoid arthritis, osteoarthritis, and ankylosing spondylitis. Fenbufen is prepared by the Friedel-Crafts (aluminum chloride – nitrobenzene) acylation of biphenyl with succinic anhydride. The compound is metabolized in humans first to 4-hydroxy-4-biphenylbutyric acid (tmax 2.5 h) then to 4-biphenyl acetic acid (tmax 7.5 h). Both metabolites are more active than fenbufen itself and circulate for several hours (t1/2 10 h). This slow conversion of fenbufen to active metabolites having relatively long plasma half-lives allows for once a day dosing with this agent.
용도
Cyclo-oxygenase inhibitor; analgesic; anti-inflammatory
일반 설명
Fenbufen belongs to the class of non-steroidal anti-inflammatory drugs, widely used as an antipyretic and analgesic in medical applications. Its mode of action involves the inhibition of cyclooxygenase enzyme and thereby prevents the synthesis of certain prostaglandins.