Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,4-Dichloropyridine
2,4-Dichlorpyridine · IFLAB-BB F2108-0071 · 2,4-DICHLOROPYRIDINE · Pyridine, 2,4-dichloro- · 2,4-Dichloropyridine>2,4 dicloropyridine 98% · 2,4-Dichloropyridine,97% · 2,4-Dichloropyridine 97% · 2,4-Dichloropyridine ,98%
식별자 및 물리적 특성
| CAS No. | 26452-80-2 |
|---|---|
| 분자식 | C5H3Cl2N |
| 평균 분자량 | 147.99 g/mol |
| 단동위원소 질량 | 146.96425446 g/mol |
| SMILES | Clc1ccnc(Cl)c1 |
| InChIKey | TYPVHTOETJVYIV-UHFFFAOYSA-N |
| PubChem CID | 33515 |
| EC No. | 247-717-7 |
| DTXSID | DTXSID20181047 |
화학 및 물리적 성질
| XLogP | 2.4 |
|---|---|
| 극성 표면적 | 12.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 76.8 |
| 녹는점 | -1 °C |
| 끓는 점 | 189-190 °C (lit.) 76-78 °C/23 mmHg (lit.) |
| 밀도 | 1.37 |
| 굴절률 | 1.55-1.554 |
| 인화점 | 189-190°C |
| 저장 조건 | Inert atmosphere,2-8°C |
| 용해도 | 클로로포름에 용해됨 |
| 물리적 상태 | 노란색에서 옅은 주황색 액체 |
| pKa(산도 계수) | 0.12±0.10(Predicted) |
| 색상 | Colorless to Red to Green |
| BRN | 108666 |
| InChI | InChI=1S/C5H3Cl2N/c6-4-1-2-8-5(7)3-4/h1-3H |
| InChIKey | TYPVHTOETJVYIV-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(Cl)=C1 |
화학적 성질
Light yellow liquid
안전 및 규제
| GHS 분류 | DangerH302 (93.8%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P262, P264, P264+P265, P270, P271, P272, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P330, P332+P317, P333+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (93.8%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | NC3410400 |
| 운송 번호(UN) | 2810 |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 25-38-41-43-36/37/38-20/22 |
| 위험 표시 | T,Xi,Xn |
| 안전 문구(S) | 26-36/37/39-45-36 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2Skin Sens. 1 |
| 위험 참고 사항 | Harmful/Irritant |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
2,4-Dichloropyridine is a versatile reactant used in the preparation of host materials for light-emitting diodes with heterocyclic cores. Also used in the preparation of sulfonylated pyridines, pyrazine and quinoline via aromatic nucleophilic substitution of azines with sodium sulfinates.