Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디갈산
디갈산 · Digallate · C:C&B47 · NSC 59263 · igallicaci · m-digallicacid · 3-galloylgallicacid · gallicacid,3-gallate
식별자 및 물리적 특성
| CAS No. | 536-08-3 |
|---|---|
| 분자식 | C14H10O9 |
| 평균 분자량 | 322.22 g/mol |
| 단동위원소 질량 | 322.03248189 g/mol |
| SMILES | O=C(O)c1cc(O)c(O)c(OC(=O)c2cc(O)c(O)c(O)c2)c1 |
| InChIKey | COVFEVWNJUOYRL-UHFFFAOYSA-N |
| PubChem CID | 341 |
| ChEMBL | CHEMBL366356 |
| ChEBI | CHEBI:30814 |
| EC No. | 208-624-7 |
| DTXSID | DTXSID50871747 |
| 현지명 | 디갈산 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 165 |
| 수소 결합 공여자 수 | 6 |
| 수소 결합 수용자 수 | 9 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 23 |
| 형식 전하 | 0 |
| 복잡도 | 442 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 267-269°C |
| 끓는 점 | 420.86°C (rough estimate) |
| 밀도 | 1.5467 (rough estimate) |
| 굴절률 | 1.7770 (estimate) |
| 저장 조건 | -20°C Freezer |
| 용해도 | DMSO: SolubleMethanol: Soluble |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 4.11±0.10(Predicted) |
| 용해도 | 0.5g/L(25℃) |
| 안정성 | 흡습성 |
| LogP(분배 계수) | 1.970 (est) |
화학적 성질
Off-White Solid
용도
개요
Digallic acid is a natural polyphenolic that can be produced by hydrolysis of gallotannins. Like other polyphenolic compounds, digallic acid has antioxidant activity that can be cytoprotective. Digallic acid inhibits reverse transcriptases from human immunodeficiency virus (Ki = 0.58 μM) and murine leukemia virus. It also inhibits calcium-activated chloride channels, blocking the initial agonist-stimulated chloride current.