Fumonisin B2 from Fusarium moniliforme, sphingosine N-acyltransferase inhibitor
FUMONISIN B3 · FB2 · FUMONISIN B2 · B2 Fumonisin B2 · FUMONISIN B2, 96+% · Diquat-d4 Dibromide · Fumonisin B2 (>90%) · fumonisin b2solution
식별자 및 물리적 특성
| CAS No. | 116355-84-1 |
|---|---|
| 분자식 | C34H59NO14 |
| 평균 분자량 | 705.8 g/mol |
| 단동위원소 질량 | 705.39355556 g/mol |
| SMILES | CCCCC(C)C(OC(=O)CC(CC(=O)O)C(=O)O)C(CC(C)CCCCCCC(O)CC(O)C(C)N)OC(=O)CC(CC(=O)O)C(=O)O |
| InChIKey | UXDPXZQHTDAXOZ-UHFFFAOYSA-N |
| PubChem CID | 3432 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 268 |
| 수소 결합 공여자 수 | 7 |
| 수소 결합 수용자 수 | 15 |
| 회전 가능 결합 수 | 31 |
| 무거운 원자 수 | 49 |
| 형식 전하 | 0 |
| 복잡도 | 1,040 |
| 녹는점 | <3200(dec) |
| 끓는 점 | 705.92°C (rough estimate) |
| 밀도 | 1.2044 (rough estimate) |
| 굴절률 | 1.6630 (estimate) |
| 인화점 | 6 °C |
| 저장 조건 | -20°C |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 회백색 고체 |
| pKa(산도 계수) | 3+-.0.23(Predicted) |
| 색상 | 미색부터 베이지까지 |
| 생물학적 소스 | Fusarium sp. (Fusarium moniliforme) |
| 안정성 | 흡습성 |
| 주요 응용 | 청소용품화장품음식 및 음료개인 위생 관리 |
| InChIKey | CFOIYOQEQJFMGC-UHFFFAOYSA-N |
| SMILES | C(CC(C)CCCCCCC(O)CC(O)C(N)C)(OC(=O)CC(C(=O)O)CC(=O)O)C(CC(C)CCC)OC(=O)CC(C(=O)O)CC(=O)O |
화학적 성질
Pale Yellow Crystalline Solid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | TZ8335000 |
| 운송 번호(UN) | UN 2811 6.1/PG 1 |
| 관세 코드 | 29221990 |
| 위험 문구(R) | 26/27/28-36/37/38-40-36-20/21/22-11 |
| 위험 표시 | T+,T,Xn,F |
| 안전 문구(S) | 22-36/37/39-45-36/37-16-26 |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2Flam. Liq. 2 |
| 저장 분류 | 3 - Flammable liquids |
용도
개요
Fumonisin B2 belongs to the family of toxins known as fumonisins. It is produced by several species of Fusarium molds primarily by Fusarium verticillioide. It is one of the major mycotoxin contaminant in corn and corn-based foods. Fumonisin B2 is a structural analog of fumonisin B1 but it is more cytotoxic than the latter and it inhibits sphinganine-N-acetyltransferase (ceramide synthase).Fumonisin B2 is a carcinogenic mycotoxin generally present on corn based food and feed-stuff, which is produced by the fungus Fusarium verticillioides and Fusarium moniliforme. Fumonisin B2 can also be detected in the industrially important fungi, Aspergillus niger.
용도
Fumonisin B2 is a minor analogue of a family of potent mycotoxins produced by various Fusarium species, associated with animal toxicity worldwide. To date much of the research on the pharmacology of the fumonisins has focused on fumonisin B1. It is generally accepted that fumonisin B2 acts on ceramide biosynthesis, however, the pharmacology of the minor analogues is less well explored.
일반 설명
Fumonisin B2 (FB2) is a diester of tricarballylic acid and polyhydric alcohols.. Fumonisins B2 (FB2) does not have one or more hydroxyl groups at the C5 or C10 positions.