Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
푸라졸리돈
푸라졸리돈 · 퓨라졸리돈 · Furazolidon · NF 180 · nf-180 · Furoxane · 3-(((5-Nitro-2-furanyl)methylene)amino)-2-oxazolidinone · Furoxone
식별자 및 물리적 특성
| CAS No. | 67-45-8 |
|---|---|
| 분자식 | C8H7N3O5 |
| 평균 분자량 | 225.16 g/mol |
| 단동위원소 질량 | 225.03857033 g/mol |
| SMILES | O=C1OCCN1N=Cc1ccc([N+](=O)[O-])o1 |
| InChIKey | PLHJDBGFXBMTGZ-UHFFFAOYSA-N |
| PubChem CID | 3435 |
| ChEMBL | CHEMBL1374738 |
| DTXSID | DTXSID4041997 |
| 현지명 | 푸라졸리돈 |
화학 및 물리적 성질
| XLogP | -0.1 |
|---|---|
| 극성 표면적 | 101 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 326 |
| 녹는점 | 254-256°C (dec.) |
| 끓는 점 | 366.66°C (rough estimate) |
| 밀도 | 1.5406 (rough estimate) |
| 굴절률 | 1.7180 (estimate) |
| 인화점 | 2 °C |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | 포름산: 용해성50mg/mL |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | -1.98±0.20(Predicted) |
| 색상 | 노란색 |
| 생물학적 소스 | synthetic |
| Merck | 14,4300 |
| BRN | 8317414 |
| 헨리 상수 | 3.0×105 mol/(m3Pa) at 25℃, HSDB (2015) |
| 안정성 | 안정적인. 타기 쉬운. 강한 산화제와 호환되지 않습니다. |
| 주요 응용 | 청소용품임상 연구화장품음식 및 음료법의학 및 독성학개인 위생 관리의약품(소분자) |
| InChI | 1S/C8H7N3O5/c12-8-10(3-4-15-8)9-5-6-1-2-7(16-6)11(13)14/h1-2,5H,3-4H2/b9-5+ |
| InChIKey | PLHJDBGFXBMTGZ-UITAMQMPSA-N |
| SMILES | [O-][N+](=O)c1ccc(\C=N\N2CCOC2=O)o1 |
| NIST | Furazolidone(67-45-8) |
| EPA | Furazolidone (67-45-8) |
화학적 성질
solid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | RQ3675000 |
| 관세 코드 | 29349990 |
| 위험 문구(R) | 62-40-36-20/21/22-11-68 |
| 위험 표시 | Xn,F |
| 안전 문구(S) | 36-22-36/37-16 |
| 기존화학 물질 | KE-25992 |
| 위험 등급 | Repr. 2 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 67-45-8(Hazardous Substances Data) |
용도
개요
Furazolidone belongs to the group of nitro furans. This antimicrobal (antibacterial and antiprotozoal) agent is used in veterinary medicine both topically and orally, particularly in animal feed. Reactions have been reported in workers exposed to it by contact with animal feed. Cross reactions with other nitrofuran derivatives are rare.
용도
The minimum inhibitory concentration of furazolidone was assessed to study the nonreplicating persistence of M. tuberculosis in aerobic and anaerobic conditions using luminescence-based low-oxygen-recovery assay.
일반 설명
Furazolidone is an effective antiprotozoal and antibacterial agent.