Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Amino-6-bromonaphthalene
F0701-0046 · NSC 407685 · 2-Amino-6-bromophthalene · 6-Bromonaphthalen-2-amine · 6-BroMo-2-naphthalenaMine · 2-Amino-6-bromonaphthalene · 6-broMo-2-aMinonaphthalene · 6-Bromonaphthalene-2-amine
식별자 및 물리적 특성
| CAS No. | 7499-66-3 |
|---|---|
| 분자식 | C10H8BrN |
| 평균 분자량 | 222.08 g/mol |
| 단동위원소 질량 | 220.98401136 g/mol |
| SMILES | Nc1ccc2cc(Br)ccc2c1 |
| InChIKey | UBLKHAWYJFEPDX-UHFFFAOYSA-N |
| PubChem CID | 348404 |
| ChEMBL | CHEMBL1495124 |
| EC No. | 640-718-7 |
| DTXSID | DTXSID60324774 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 26 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 160 |
| SpringerMaterials Properties | Density |
| 녹는점 | 128 °C |
| 끓는 점 | 155-160 °C(Press: 1 Torr) |
| 밀도 | 1.563±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 3.66±0.10(Predicted) |
| 색상 | 회색 |
| InChI | InChI=1S/C10H8BrN/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6H,12H2 |
| InChIKey | UBLKHAWYJFEPDX-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(Br)C=C2)=CC=C1N |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 관세 코드 | 2921450090 |
| 위험 참고 사항 | Irritant |
용도
용도
6-Bromonaphthalen-2-amine is used in the new synthesis of alkylsulphanylnaphthalenes and the synthesis and mesomorphic properties of novel naphthylisothiocyanates.