Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-Propylboronic acid
N-PROPYLBORONIC ACID · Propylboronic · Propylboronicaci · PROPYLBORONIC ACID · Propaneboronic acid · RARECHEM AH PB 0255 · B-Propylboronic acid · Boronic acid, B-propyl-
식별자 및 물리적 특성
| CAS No. | 17745-45-8 |
|---|---|
| 분자식 | C3H9BO2 |
| 평균 분자량 | 87.92 g/mol |
| 단동위원소 질량 | 88.06955993 g/mol |
| SMILES | CCCB(O)O |
| InChIKey | JAQOMSTTXPGKTN-UHFFFAOYSA-N |
| PubChem CID | 351065 |
| EC No. | 681-581-3 |
| DTXSID | DTXSID90325794 |
화학 및 물리적 성질
| 극성 표면적 | 40.5 |
|---|---|
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 6 |
| 형식 전하 | 0 |
| 복잡도 | 30 |
| 녹는점 | 105-108°C |
| 끓는 점 | 170.8±23.0 °C(Predicted) |
| 밀도 | 0.925±0.06 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,Store in freezer, under -20°C |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| pKa(산도 계수) | 10.31±0.43(Predicted) |
| 물리적 상태 | 결정질 분말 또는 플레이크 |
| 색상 | 흰색에서 황백색까지 |
| BRN | 1731884 |
| InChI | InChI=1S/C3H9BO2/c1-3(2)4(5)6/h3,5-6H,1-2H3 |
| InChIKey | QIPHSSYCQCBJAX-UHFFFAOYSA-N |
| SMILES | CC(B(O)O)C |
화학적 성질
White to light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| TSCA 등재 상태 | No |
| 관세 코드 | 29319090 |
| 위험 문구(R) | 36/37/38-22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 37/39-26 |
| 위험 등급 | IRRITANTAcute Tox. 4 Oral |
| 저장 분류 | 13 - Non Combustible Solids |
용도
용도
N-Propylboronic Acid is a chemical reagent used in the synthesis of pharmaceutical agents such as inhibitors of mTOR for use in anti-tumor treatments. Also used to synthesize endothelial lipase inhibitors