식별자 및 물리적 특성
| CAS No. | 355429-09-3 |
|---|
| 분자식 | C27H23NO3 |
|---|
| 평균 분자량 | 409.5 g/mol |
|---|
| 단동위원소 질량 | 409.1677936 g/mol |
|---|
| SMILES | CCc1ccc(C(=O)COC(=O)c2cc(-c3ccccc3)nc3c(C)cccc23)cc1 |
|---|
| InChIKey | GLWAQMHVJSAOMO-UHFFFAOYSA-N |
|---|
| PubChem CID | 3537814 |
|---|
| EC No. | 632-535-6 |
|---|
화학 및 물리적 성질
| XLogP | 6.3 |
|---|
| 극성 표면적 | 56.3 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 7 |
|---|
| 무거운 원자 수 | 31 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 606 |
|---|
안전 및 규제
| GHS 분류 | H413 (100%): May cause long lasting harmful effects to aquatic life [Hazardous to the aquatic environment, long-term hazard]P273, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Aquatic Chronic 4 (100%) |
|---|
