Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
9-안트라세닐메틸메타크릴레이트
9-안트라세닐메틸메타크릴레이트 · AMMA · Anthracen-9-ylmethyl methacrylate · ANMA · DK738 · POLYFLUOR(R) 407 · (9-ANTHRYL) METHACRYLATE · 9-Anthrylmethyl Methacrylate
식별자 및 물리적 특성
| CAS No. | 31645-35-9 |
|---|---|
| 분자식 | C19H16O2 |
| 평균 분자량 | 276.3 g/mol |
| 단동위원소 질량 | 276.11502975 g/mol |
| SMILES | C=C(C)C(=O)OCc1c2ccccc2cc2ccccc12 |
| InChIKey | MJYSISMEPNOHEG-UHFFFAOYSA-N |
| PubChem CID | 3618754 |
| EC No. | 636-528-9 |
| DTXSID | DTXSID70953610 |
| 현지명 | 9-안트라세닐메틸메타크릴레이트 |
화학 및 물리적 성질
| XLogP | 5.1 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 378 |
| 녹는점 | 80-85 °C (lit.) |
| 끓는 점 | 443.0±14.0 °C(Predicted) |
| 밀도 | 1.159±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep Cold |
| 용해도 | 됨에 용해됨아세톤, 클로로포름, 클로로메탄, 핫에탄올, 에틸아세테이트, |
| 물리적 상태 | 고체 |
| 색상 | 옅은 노랑 |
| InChI | InChI=1S/C19H16O2/c1-13(2)19(20)21-12-18-16-9-5-3-7-14(16)11-15-8-4-6-10-17(15)18/h3-11H,1,12H2,2H3 |
| InChIKey | MJYSISMEPNOHEG-UHFFFAOYSA-N |
| SMILES | C(OCC1C2=CC=CC=C2C=C2C=1C=CC=C2)(=O)C(C)=C |
화학적 성질
Pale Yellow Crystals
안전 및 규제
| GHS 분류 | DangerH315 (58.9%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P273, P280, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P332+P317, P337+P317, P362+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 95 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (58.9%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29161290 |
| 위험 문구(R) | 41 |
| 위험 표시 | Xi,F |
| 안전 문구(S) | 25-26-36/39 |
| 위험 등급 | Eye Dam. 1 |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
9-Anthrylmethyl Methacrylate is a fluorescent copolymer used as an optic fiber sensor for determination of Tetracycline.
용도
A fluorescent copolymer as optic fiber sensor for determination of Tetracycline.