Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 3695553생성일: 2026년 11월 4일
2-((4-(3-Methylphenyl)-5-(((4-methylphenyl)sulfanyl)methyl)-4H-1,2,4-triazol-3-YL)sulfanyl)-N-(2-(trifluoromethyl)phenyl)acetamide
SALOR-INT L444944-1EA · 2-[(4-(3-METHYLPHENYL)-5-([(4-METHYLPHENYL)SULFANYL]METHYL)-4H-1,2,4-TRIAZOL-3-YL)SULFANYL]-N-[2-(TRIFLUOROMETHYL)PHENYL]ACETAMIDE
https://huagongshe.com/ko/chemical/3695553
식별자 및 물리적 특성
| CAS No. | 539811-32-0 |
|---|
| 분자식 | C26H23F3N4OS2 |
|---|
| 평균 분자량 | 528.6 g/mol |
|---|
| 단동위원소 질량 | 528.1265382 g/mol |
|---|
| SMILES | Cc1ccc(SCc2nnc(SCC(=O)Nc3ccccc3C(F)(F)F)n2-c2cccc(C)c2)cc1 |
|---|
| InChIKey | IEOCLOPMJRHAOB-UHFFFAOYSA-N |
|---|
| PubChem CID | 3695553 |
|---|
| EC No. | 644-611-6 |
|---|
화학 및 물리적 성질
| XLogP | 6.5 |
|---|
| 극성 표면적 | 110 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 8 |
|---|
| 회전 가능 결합 수 | 8 |
|---|
| 무거운 원자 수 | 36 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 707 |
|---|
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P273, P280, P301+P316, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
|---|
| 신호 어 | Danger |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H301 |
|---|
