Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 3697795생성일: 2026년 11월 3일
1-[5-(Diethylamino)pentan-2-yl]-3-naphthalen-1-ylurea
1-(4-Diethylamino-1-methyl-butyl)-3-naphthalen-1-YL-urea · Urea, N-[4-(diethylamino)-1-methylbutyl]-N'-1-naphthalenyl-
https://huagongshe.com/ko/chemical/3697795
식별자 및 물리적 특성
| CAS No. | 305849-24-5 |
|---|
| 분자식 | C20H29N3O |
|---|
| 평균 분자량 | 327.5 g/mol |
|---|
| 단동위원소 질량 | 327.23106256 g/mol |
|---|
| SMILES | CCN(CC)CCCC(C)NC(=O)Nc1cccc2ccccc12 |
|---|
| InChIKey | RIYZFSVCQTXEPM-UHFFFAOYSA-N |
|---|
| PubChem CID | 3697795 |
|---|
| EC No. | 153-257-7 |
|---|
화학 및 물리적 성질
| XLogP | 4.1 |
|---|
| 극성 표면적 | 44.4 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 2 |
|---|
| 회전 가능 결합 수 | 8 |
|---|
| 무거운 원자 수 | 24 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 370 |
|---|
| 끓는 점 | 462.8±37.0 °C(Predicted) |
|---|
| 밀도 | 1.073±0.06 g/cm3(Predicted) |
|---|
| pKa(산도 계수) | 13.57±0.46(Predicted) |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P273, P301+P317, P330, P391, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
|---|
![1-[5-(Diethylamino)pentan-2-yl]-3-naphthalen-1-ylurea 분자 구조식](/img/chemical/3697795.png)