Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-클로로-2-플루오로-5-니트로벤조익산
4-클로로-2-플루오로-5-니트로벤조익산 · Pibrentasvir Impurity 13 · 4-Chloro-2-fluoro-5-nitrobenzoic · 4-chloro-2-fluoro-5-nitrobenzoate · 4-Chloro-2-fluoro-5-nitrobenzoic acid · 2-Fluoro-4-chloro-5-nitrobenzoic acid · 5-Carboxy-2-chloro-4-fluoronitrobenzene · 4-Chloro-2-fluoro-5-nitrobenzoicacid98%
식별자 및 물리적 특성
| CAS No. | 35112-05-1 |
|---|---|
| 분자식 | C7H3ClFNO4 |
| 평균 분자량 | 219.55 g/mol |
| 단동위원소 질량 | 218.9734634 g/mol |
| SMILES | O=C(O)c1cc([N+](=O)[O-])c(Cl)cc1F |
| InChIKey | KAONECPATVTFST-UHFFFAOYSA-N |
| PubChem CID | 3774553 |
| EC No. | 630-011-1 |
| DTXSID | DTXSID40396252 |
| 현지명 | 4-클로로-2-플루오로-5-니트로벤조익산 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 83.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 257 |
| 녹는점 | 146-150°C |
| 끓는 점 | 361.4±42.0 °C(Predicted) |
| 밀도 | 1.689±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 2.45±0.12(Predicted) |
| 색상 | 하얀색 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 2916399090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39 |
| 위험 참고 사항 | Irritant/Keep Cold |
용도
용도
4-Chloro-2-fluoro-5-nitrobenzoic acid is a commercially available multireactive building block that can serve as a starting material in heterocyclic oriented synthesis (HOS) leading to various condensed nitrogenous cycles.