Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Khellin
VISNAGIN · eskel · norkel · KHELIN · keloid · ammivin · KHELLIN · chellin
식별자 및 물리적 특성
| CAS No. | 82-02-0 |
|---|---|
| 분자식 | C14H12O5 |
| 평균 분자량 | 260.24 g/mol |
| 단동위원소 질량 | 260.06847348 g/mol |
| SMILES | COc1c2occc2c(OC)c2c(=O)cc(C)oc12 |
| InChIKey | HSMPDPBYAYSOBC-UHFFFAOYSA-N |
| PubChem CID | 3828 |
| ChEMBL | CHEMBL44746 |
| ChEBI | CHEBI:6133 |
| EC No. | 201-392-8 |
| DTXSID | DTXSID9045267 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 57.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 405 |
| 지질 | Polyketides [PK] -> Aromatic polyketides [PK13] -> Benzopyranoids [PK1311] |
| Collision Cross Section | 151.6 Ų [M+H]+ [CCS Type: DTBuffer gas: N2Ionization: APCI+Dataset: TOXCASTSource Identifier: DTXSID9045267] |
| 녹는점 | 150154°C |
| 끓는 점 | 180200°C0.05mm Hg |
| 밀도 | 1.1954 (rough estimate) |
| 굴절률 | 1.4560 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 수정 같은 |
| 색상 | 연노랑 |
| 용해도 | 247.2g/L(25℃) |
| Merck | 14,5309 |
| BRN | 263185 |
| 주요 응용 | 음식 및 음료 |
| InChI | 1S/C14H12O5/c1-7-6-9(15)10-11(16-2)8-4-5-18-12(8)14(17-3)13(10)19-7/h4-6H,1-3H3 |
| InChIKey | HSMPDPBYAYSOBC-UHFFFAOYSA-N |
| SMILES | COc1c2OC(C)=CC(=O)c2c(OC)c3ccoc13 |
| LogP(분배 계수) | 1.770 (est) |
| EPA | Khellin (82-02-0) |
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P270, P280, P301+P316, P302+P352, P321, P330, P332+P317, P362+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | LV1050000 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 독성 | LD50 in mice, rats (mg/kg): 30.6, 34.4 i.v.50.8, 68.8 orally (Busch) |
| 관세 코드 | 2932.99.7000 |
| 위험 문구(R) | 25-38-36/37/38-23/24/25 |
| 위험 표시 | T |
| 안전 문구(S) | 36/37/39-45-26 |
| 포장분류 | III |
| 위험 등급 | 6.1(b)Acute Tox. 3 DermalAcute Tox. 3 InhalationAcute Tox. 3 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
Khellin has been used as a reference standard for supercritical fluid extraction of khellin from Ammi visnaga L. fruits to understand the various medicinal effects of γ-Pyrones by reversed phase HPLC method.
일반 설명
Khellin, is reported to be an efficient drug for treating vitiligo when combined with ultraviolet A irradiation.